The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID104223916 ID: ALA3183925
PubChem CID: 49852809
Max Phase: Preclinical
Molecular Formula: C24H17FN6O4
Molecular Weight: 472.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N#CNC(=O)c1ccc(-n2cccc2/C=C2\NC(=O)N(CC(=O)Nc3cccc(F)c3)C2=O)cc1
Standard InChI: InChI=1S/C24H17FN6O4/c25-16-3-1-4-17(11-16)28-21(32)13-31-23(34)20(29-24(31)35)12-19-5-2-10-30(19)18-8-6-15(7-9-18)22(33)27-14-26/h1-12H,13H2,(H,27,33)(H,28,32)(H,29,35)/b20-12-
Standard InChI Key: FEPBDJUPXCYVBO-NDENLUEZSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
2.3046 0.7646 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.0216 -1.1628 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2815 -4.0509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9937 -1.2899 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4908 2.4067 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0989 -2.6311 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1910 -1.3047 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2068 -2.9085 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1922 -2.0684 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9150 2.4067 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9150 4.0509 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1210 -2.0879 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3142 -1.9166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4533 -3.2440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5194 -1.7907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7351 -1.5363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1910 -0.4797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9192 -2.7171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7749 -2.5739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8537 -1.7896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3685 -2.0250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5993 -2.5761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4815 -0.0672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9087 -0.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2028 1.1708 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4834 0.7583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9109 0.7589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6421 -1.3771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2028 1.9958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2678 -0.6420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4660 -1.4205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7171 0.0496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9150 -0.7292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5410 0.0059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9150 3.2286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 32 1 0
2 13 2 0
3 14 2 0
4 21 2 0
5 29 2 0
6 13 1 0
6 14 1 0
6 18 1 0
7 15 1 0
7 17 1 0
7 20 1 0
8 12 1 0
8 14 1 0
9 21 1 0
9 28 1 0
10 29 1 0
10 35 1 0
11 35 3 0
12 13 1 0
12 16 2 0
15 16 1 0
15 19 2 0
17 23 2 0
17 24 1 0
18 21 1 0
19 22 1 0
20 22 2 0
23 26 1 0
24 27 2 0
25 26 2 0
25 27 1 0
25 29 1 0
28 30 1 0
28 31 2 0
30 32 2 0
31 33 1 0
32 34 1 0
33 34 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 472.44Molecular Weight (Monoisotopic): 472.1295AlogP: 2.36#Rotatable Bonds: 6Polar Surface Area: 136.33Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.48CX Basic pKa: ┄CX LogP: 1.89CX LogD: 1.89Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.22Np Likeness Score: -1.95
References 1. PubChem BioAssay data set,