The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID144097032 ID: ALA3184030
PubChem CID: 60159071
Max Phase: Preclinical
Molecular Formula: C27H34N4O5
Molecular Weight: 494.59
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCNC(=O)Nc1ccc2c(c1)C(=O)N(C)[C@H]1CC[C@H](CC(=O)N[C@H](C)c3ccccc3)O[C@@H]1CO2
Standard InChI: InChI=1S/C27H34N4O5/c1-4-28-27(34)30-19-10-13-23-21(14-19)26(33)31(3)22-12-11-20(36-24(22)16-35-23)15-25(32)29-17(2)18-8-6-5-7-9-18/h5-10,13-14,17,20,22,24H,4,11-12,15-16H2,1-3H3,(H,29,32)(H2,28,30,34)/t17-,20-,22+,24-/m1/s1
Standard InChI Key: YBRLGVDHYMUGPQ-SESZIYJCSA-N
Molfile:
RDKit 2D
36 39 0 0 1 0 0 0 0 0999 V2000
-0.7488 1.8040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.0803 1.5146 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2080 -2.9126 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6557 3.6000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6373 -3.6186 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7488 -1.8040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.6864 -1.5230 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9946 3.7474 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.9753 -3.7810 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7869 -0.7658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7869 -0.7658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7488 -1.8040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7869 0.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7869 0.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0803 -1.5146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7488 1.8040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0803 -1.5146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3908 0.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3908 -0.7658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0803 1.5146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3908 -0.7658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3908 0.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2080 -2.9126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6913 1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6940 2.9985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6795 -3.0238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9973 5.2482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2979 5.9971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3028 7.4972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5947 5.2430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9590 5.8498 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.9683 -5.2818 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6043 8.2430 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8961 5.9889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9009 7.4889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.0044 -5.8873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 14 1 0
1 16 1 0
2 13 1 0
2 18 1 0
3 12 2 0
4 25 2 0
5 26 2 0
6 11 1 0
6 12 1 0
6 23 1 0
7 19 1 0
7 26 1 0
8 25 1 0
8 27 1 0
9 26 1 0
9 32 1 0
10 12 1 0
10 14 1 0
10 15 2 0
11 13 1 0
11 17 1 6
13 16 1 1
14 20 2 0
15 19 1 0
17 21 1 0
18 21 1 0
18 24 1 1
19 22 2 0
20 22 1 0
24 25 1 0
27 28 1 0
27 31 1 6
28 29 2 0
28 30 1 0
29 33 1 0
30 34 2 0
32 36 1 0
33 35 2 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.59Molecular Weight (Monoisotopic): 494.2529AlogP: 3.48#Rotatable Bonds: 6Polar Surface Area: 109.00Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.79CX Basic pKa: ┄CX LogP: 2.24CX LogD: 2.24Aromatic Rings: 2Heavy Atoms: 36QED Weighted: 0.57Np Likeness Score: -0.71
References 1. PubChem BioAssay data set,