The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID131457170 ID: ALA3184271
PubChem CID: 54660701
Max Phase: Preclinical
Molecular Formula: C28H26N2O6
Molecular Weight: 486.52
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)[C@@H]1[C@@H](CO)[C@@H]2Cn3c(ccc(/C=C/c4ccccc4)c3=O)[C@@H]2N1Cc1ccc2c(c1)OCO2
Standard InChI: InChI=1S/C28H26N2O6/c31-15-21-20-14-29-22(10-9-19(27(29)32)8-6-17-4-2-1-3-5-17)25(20)30(26(21)28(33)34)13-18-7-11-23-24(12-18)36-16-35-23/h1-12,20-21,25-26,31H,13-16H2,(H,33,34)/b8-6+/t20-,21-,25+,26-/m0/s1
Standard InChI Key: JUBZNFCZFZOAAP-KURLUARPSA-N
Molfile:
RDKit 2D
36 41 0 0 1 0 0 0 0 0999 V2000
7.1198 -0.3350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9090 4.9053 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3067 4.6082 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.0586 3.7732 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9544 3.4657 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9544 2.1308 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5969 3.2108 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8227 1.0627 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6831 2.3903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4901 2.2188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2706 1.6758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9026 2.9332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.3506 3.5463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5763 1.3983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5677 0.2781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8824 3.6233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4637 1.5043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5221 4.3533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7608 0.1066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7231 3.0195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2087 0.7197 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1680 3.2108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4535 3.6233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5058 -0.6780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7390 3.2108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1680 2.3858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7390 2.3858 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4535 1.9733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6989 -0.8496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4695 2.7983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4439 -1.6342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9959 -2.2473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6369 -1.8057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7410 -3.0319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3820 -2.5903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9340 -3.2034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 15 2 0
2 18 2 0
3 18 1 0
4 20 1 0
5 25 1 0
5 30 1 0
6 27 1 0
6 30 1 0
9 7 1 6
7 13 1 0
7 16 1 0
8 11 1 0
8 14 1 0
8 15 1 0
9 10 1 0
9 11 1 0
10 12 1 0
10 14 1 6
11 17 2 0
12 13 1 0
12 20 1 1
13 18 1 6
15 19 1 0
16 22 1 0
17 21 1 0
19 21 2 0
19 24 1 0
22 23 1 0
22 26 2 0
23 25 2 0
24 29 2 0
25 27 1 0
26 28 1 0
27 28 2 0
29 31 1 0
31 32 2 0
31 33 1 0
32 34 1 0
33 35 2 0
34 36 2 0
35 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 486.52Molecular Weight (Monoisotopic): 486.1791AlogP: 3.00#Rotatable Bonds: 6Polar Surface Area: 101.23Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 1.09CX Basic pKa: 8.05CX LogP: -0.52CX LogD: -0.59Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.55Np Likeness Score: 0.13
References 1. PubChem BioAssay data set,