SID131457170

ID: ALA3184271

PubChem CID: 54660701

Max Phase: Preclinical

Molecular Formula: C28H26N2O6

Molecular Weight: 486.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O)[C@@H]1[C@@H](CO)[C@@H]2Cn3c(ccc(/C=C/c4ccccc4)c3=O)[C@@H]2N1Cc1ccc2c(c1)OCO2

Standard InChI:  InChI=1S/C28H26N2O6/c31-15-21-20-14-29-22(10-9-19(27(29)32)8-6-17-4-2-1-3-5-17)25(20)30(26(21)28(33)34)13-18-7-11-23-24(12-18)36-16-35-23/h1-12,20-21,25-26,31H,13-16H2,(H,33,34)/b8-6+/t20-,21-,25+,26-/m0/s1

Standard InChI Key:  JUBZNFCZFZOAAP-KURLUARPSA-N

Molfile:  

     RDKit          2D

 36 41  0  0  1  0  0  0  0  0999 V2000
    7.1198   -0.3350    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9090    4.9053    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.3067    4.6082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0586    3.7732    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9544    3.4657    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9544    2.1308    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5969    3.2108    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8227    1.0627    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6831    2.3903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4901    2.2188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2706    1.6758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9026    2.9332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3506    3.5463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5763    1.3983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5677    0.2781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8824    3.6233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4637    1.5043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5221    4.3533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7608    0.1066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7231    3.0195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2087    0.7197    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1680    3.2108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4535    3.6233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5058   -0.6780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7390    3.2108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1680    2.3858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7390    2.3858    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4535    1.9733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6989   -0.8496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4695    2.7983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4439   -1.6342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9959   -2.2473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6369   -1.8057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7410   -3.0319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3820   -2.5903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9340   -3.2034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 15  2  0
  2 18  2  0
  3 18  1  0
  4 20  1  0
  5 25  1  0
  5 30  1  0
  6 27  1  0
  6 30  1  0
  9  7  1  6
  7 13  1  0
  7 16  1  0
  8 11  1  0
  8 14  1  0
  8 15  1  0
  9 10  1  0
  9 11  1  0
 10 12  1  0
 10 14  1  6
 11 17  2  0
 12 13  1  0
 12 20  1  1
 13 18  1  6
 15 19  1  0
 16 22  1  0
 17 21  1  0
 19 21  2  0
 19 24  1  0
 22 23  1  0
 22 26  2  0
 23 25  2  0
 24 29  2  0
 25 27  1  0
 26 28  1  0
 27 28  2  0
 29 31  1  0
 31 32  2  0
 31 33  1  0
 32 34  1  0
 33 35  2  0
 34 36  2  0
 35 36  1  0
M  END

Associated Targets(Human)

CASP6 Tchem Caspase-6 (1213 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 486.52Molecular Weight (Monoisotopic): 486.1791AlogP: 3.00#Rotatable Bonds: 6
Polar Surface Area: 101.23Molecular Species: ACIDHBA: 7HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 1.09CX Basic pKa: 8.05CX LogP: -0.52CX LogD: -0.59
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.55Np Likeness Score: 0.13

References

1. PubChem BioAssay data set, 

Source

Source(1):