SID131428218

ID: ALA3186240

PubChem CID: 54631974

Max Phase: Preclinical

Molecular Formula: C23H30ClN3O5S

Molecular Weight: 496.03

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CO[C@H]1CN(C)C(=O)c2ccc(NS(=O)(=O)c3cccc(Cl)c3)cc2OC[C@@H](C)NC[C@H]1C

Standard InChI:  InChI=1S/C23H30ClN3O5S/c1-15-12-25-16(2)14-32-21-11-18(26-33(29,30)19-7-5-6-17(24)10-19)8-9-20(21)23(28)27(3)13-22(15)31-4/h5-11,15-16,22,25-26H,12-14H2,1-4H3/t15-,16-,22+/m1/s1

Standard InChI Key:  PSXVKIUCJIMJLV-MCFFVMPBSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  1  0  0  0  0  0999 V2000
    0.7796    5.7007    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -1.0914    3.5403    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.5591    2.1901    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2812    3.3844    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9015    3.6962    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0914   -0.2403    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.0537    0.0297    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2473    2.7302    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0268    0.8399    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1182    2.7302    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.6236    1.1099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7796    1.9200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6236    2.1901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9355    4.3504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2473    0.5698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1559    2.4601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1559    0.8399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7796    1.3800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1559    4.6205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5591    4.8905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    5.4306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6505    0.2998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4300    0.5698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4032    5.7007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7150    3.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6236    5.9707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5859    1.3800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4946    3.2703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1827    1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9623    1.9200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3655    1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6505    4.0804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8332    0.2998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 21  1  0
  2  4  2  0
  2  5  2  0
  2  8  1  0
  2 14  1  0
  3 12  1  0
  3 25  1  0
  6 15  2  0
 23  7  1  1
  7 33  1  0
  8 13  1  0
  9 15  1  0
  9 22  1  0
  9 29  1  0
 10 28  1  0
 10 30  1  0
 11 12  1  0
 11 15  1  0
 11 17  2  0
 12 16  2  0
 13 16  1  0
 13 18  2  0
 14 19  1  0
 14 20  2  0
 17 18  1  0
 19 21  2  0
 20 24  1  0
 21 26  1  0
 22 23  1  0
 23 27  1  0
 24 26  2  0
 25 28  1  0
 27 30  1  0
 27 31  1  1
 28 32  1  1
M  END

Associated Targets(Human)

CASP6 Tchem Caspase-6 (1213 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 496.03Molecular Weight (Monoisotopic): 495.1595AlogP: 3.23#Rotatable Bonds: 4
Polar Surface Area: 96.97Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.35CX Basic pKa: 8.49CX LogP: 1.73CX LogD: 1.56
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.68Np Likeness Score: -0.66

References

1. PubChem BioAssay data set, 

Source

Source(1):