The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID131428218 ID: ALA3186240
PubChem CID: 54631974
Max Phase: Preclinical
Molecular Formula: C23H30ClN3O5S
Molecular Weight: 496.03
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CO[C@H]1CN(C)C(=O)c2ccc(NS(=O)(=O)c3cccc(Cl)c3)cc2OC[C@@H](C)NC[C@H]1C
Standard InChI: InChI=1S/C23H30ClN3O5S/c1-15-12-25-16(2)14-32-21-11-18(26-33(29,30)19-7-5-6-17(24)10-19)8-9-20(21)23(28)27(3)13-22(15)31-4/h5-11,15-16,22,25-26H,12-14H2,1-4H3/t15-,16-,22+/m1/s1
Standard InChI Key: PSXVKIUCJIMJLV-MCFFVMPBSA-N
Molfile:
RDKit 2D
33 35 0 0 1 0 0 0 0 0999 V2000
0.7796 5.7007 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.0914 3.5403 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.5591 2.1901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2812 3.3844 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9015 3.6962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0914 -0.2403 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0537 0.0297 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2473 2.7302 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.0268 0.8399 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.1182 2.7302 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6236 1.1099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7796 1.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6236 2.1901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9355 4.3504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2473 0.5698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1559 2.4601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1559 0.8399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7796 1.3800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1559 4.6205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5591 4.8905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 5.4306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6505 0.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4300 0.5698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4032 5.7007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7150 3.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6236 5.9707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5859 1.3800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4946 3.2703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1827 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9623 1.9200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3655 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6505 4.0804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8332 0.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 21 1 0
2 4 2 0
2 5 2 0
2 8 1 0
2 14 1 0
3 12 1 0
3 25 1 0
6 15 2 0
23 7 1 1
7 33 1 0
8 13 1 0
9 15 1 0
9 22 1 0
9 29 1 0
10 28 1 0
10 30 1 0
11 12 1 0
11 15 1 0
11 17 2 0
12 16 2 0
13 16 1 0
13 18 2 0
14 19 1 0
14 20 2 0
17 18 1 0
19 21 2 0
20 24 1 0
21 26 1 0
22 23 1 0
23 27 1 0
24 26 2 0
25 28 1 0
27 30 1 0
27 31 1 1
28 32 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 496.03Molecular Weight (Monoisotopic): 495.1595AlogP: 3.23#Rotatable Bonds: 4Polar Surface Area: 96.97Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.35CX Basic pKa: 8.49CX LogP: 1.73CX LogD: 1.56Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.68Np Likeness Score: -0.66
References 1. PubChem BioAssay data set,