The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID162403667 ID: ALA3187013
PubChem CID: 52995696
Max Phase: Preclinical
Molecular Formula: C19H23ClN4O3
Molecular Weight: 354.41
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(OC)c(Nc2nc(NCCCO)c3ccccc3n2)c1.Cl
Standard InChI: InChI=1S/C19H22N4O3.ClH/c1-25-13-8-9-17(26-2)16(12-13)22-19-21-15-7-4-3-6-14(15)18(23-19)20-10-5-11-24;/h3-4,6-9,12,24H,5,10-11H2,1-2H3,(H2,20,21,22,23);1H
Standard InChI Key: IUGSZXMLAKNZSV-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 28 0 0 0 0 0 0 0 0999 V2000
-6.5071 -3.0146 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2955 -5.9911 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8729 7.2115 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9091 -1.5019 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 2.9981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9067 -3.0027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2030 -3.7575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6050 -3.7481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5995 -5.2481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1976 -5.2575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8958 -6.0028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 3.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5432 -3.6199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5812 5.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2593 -5.3859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8775 6.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3534 0.5301 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 13 1 0
1 23 1 0
2 17 1 0
2 25 1 0
3 26 1 0
4 9 2 0
4 11 1 0
5 10 1 0
5 11 2 0
6 11 1 0
6 12 1 0
7 10 1 0
7 22 1 0
8 9 1 0
8 10 2 0
8 14 1 0
9 15 1 0
12 13 1 0
12 16 2 0
13 18 2 0
14 19 2 0
15 20 2 0
16 17 1 0
17 21 2 0
18 21 1 0
19 20 1 0
22 24 1 0
24 26 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 354.41Molecular Weight (Monoisotopic): 354.1692AlogP: 3.18#Rotatable Bonds: 8Polar Surface Area: 88.53Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.56CX Basic pKa: 4.32CX LogP: 2.67CX LogD: 2.67Aromatic Rings: 3Heavy Atoms: 26QED Weighted: 0.54Np Likeness Score: -1.11
References 1. PubChem BioAssay data set,