The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID104223914 ID: ALA3187969
PubChem CID: 49852924
Max Phase: Preclinical
Molecular Formula: C24H17ClN6O4
Molecular Weight: 488.89
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N#CNC(=O)c1ccc(-n2cccc2/C=C2\NC(=O)N(CC(=O)Nc3ccc(Cl)cc3)C2=O)cc1
Standard InChI: InChI=1S/C24H17ClN6O4/c25-16-5-7-17(8-6-16)28-21(32)13-31-23(34)20(29-24(31)35)12-19-2-1-11-30(19)18-9-3-15(4-10-18)22(33)27-14-26/h1-12H,13H2,(H,27,33)(H,28,32)(H,29,35)/b20-12-
Standard InChI Key: OQMZLFHZOOVBEY-NDENLUEZSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
3.9348 0.7211 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.0022 -1.1630 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3009 -4.0516 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9748 -1.2901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5109 2.4071 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0798 -2.6315 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2107 -1.3049 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2261 -2.9090 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1734 -2.0687 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9348 2.4071 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9348 4.0516 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.1403 -2.0883 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3336 -1.9169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4729 -3.2446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5390 -1.7910 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7545 -1.5366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2107 -0.4799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8997 -2.7176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7945 -2.5743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8734 -1.7899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3494 -2.0253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6191 -2.5765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5013 -0.0672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9284 -0.0667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2228 1.1710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5029 0.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9309 0.7590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6234 -1.3773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2228 1.9961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4472 -1.4208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2491 -0.6421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5222 0.0059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8965 -0.7293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6982 0.0496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9348 3.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 32 1 0
2 13 2 0
3 14 2 0
4 21 2 0
5 29 2 0
6 13 1 0
6 14 1 0
6 18 1 0
7 15 1 0
7 17 1 0
7 20 1 0
8 12 1 0
8 14 1 0
9 21 1 0
9 28 1 0
10 29 1 0
10 35 1 0
11 35 3 0
12 13 1 0
12 16 2 0
15 16 1 0
15 19 2 0
17 23 2 0
17 24 1 0
18 21 1 0
19 22 1 0
20 22 2 0
23 26 1 0
24 27 2 0
25 26 2 0
25 27 1 0
25 29 1 0
28 30 2 0
28 31 1 0
30 33 1 0
31 34 2 0
32 33 2 0
32 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 488.89Molecular Weight (Monoisotopic): 488.1000AlogP: 2.87#Rotatable Bonds: 6Polar Surface Area: 136.33Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.49CX Basic pKa: ┄CX LogP: 2.35CX LogD: 2.35Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.21Np Likeness Score: -1.82
References 1. PubChem BioAssay data set,