The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID104223903 ID: ALA3188444
PubChem CID: 49852980
Max Phase: Preclinical
Molecular Formula: C22H15ClN2O4S
Molecular Weight: 438.89
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(O)c1ccc(-n2cccc2/C=C2\SC(=O)N(Cc3cccc(Cl)c3)C2=O)cc1
Standard InChI: InChI=1S/C22H15ClN2O4S/c23-16-4-1-3-14(11-16)13-25-20(26)19(30-22(25)29)12-18-5-2-10-24(18)17-8-6-15(7-9-17)21(27)28/h1-12H,13H2,(H,27,28)/b19-12-
Standard InChI Key: DNVAEOSHFJESHG-UNOMPAQXSA-N
Molfile:
RDKit 2D
30 33 0 0 0 0 0 0 0 0999 V2000
-0.7351 3.7116 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-2.0867 -1.0143 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.3470 0.2110 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2253 -0.0911 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2223 -3.6973 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2253 -2.2733 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8100 0.2872 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4885 -2.9951 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2692 -0.9277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0983 -0.1238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4215 -0.2625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9722 -2.3207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7183 -1.5385 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3337 -2.9951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8959 1.1048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7596 -2.5815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2308 1.5884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9717 -3.6589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7572 -3.4067 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7509 -3.7116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7504 -2.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9905 -2.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3165 2.4090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5836 -3.7069 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5743 -2.2834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4765 1.2525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6489 2.8937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8127 -2.9877 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1911 1.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1050 2.5582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 27 1 0
2 9 1 0
2 11 1 0
3 10 2 0
4 11 2 0
5 28 2 0
6 28 1 0
7 10 1 0
7 11 1 0
7 15 1 0
8 12 1 0
8 14 1 0
8 18 1 0
9 10 1 0
9 13 2 0
12 13 1 0
12 16 2 0
14 20 2 0
14 21 1 0
15 17 1 0
16 19 1 0
17 23 2 0
17 26 1 0
18 19 2 0
20 24 1 0
21 25 2 0
22 24 2 0
22 25 1 0
22 28 1 0
23 27 1 0
26 29 2 0
27 30 2 0
29 30 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 438.89Molecular Weight (Monoisotopic): 438.0441AlogP: 5.07#Rotatable Bonds: 5Polar Surface Area: 79.61Molecular Species: ACIDHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.64CX Basic pKa: ┄CX LogP: 4.94CX LogD: 2.25Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.56Np Likeness Score: -1.90
References 1. PubChem BioAssay data set,