SID144198761

ID: ALA3188626

PubChem CID: 60192724

Max Phase: Preclinical

Molecular Formula: C25H23N3O2S

Molecular Weight: 429.55

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1ccccc1S(=O)(=O)N1[C@@H]2CNC[C@H]1[C@@H]2c1ccc(-c2ccc(C#N)cc2)cc1

Standard InChI:  InChI=1S/C25H23N3O2S/c1-17-4-2-3-5-24(17)31(29,30)28-22-15-27-16-23(28)25(22)21-12-10-20(11-13-21)19-8-6-18(14-26)7-9-19/h2-13,22-23,25,27H,15-16H2,1H3/t22-,23+,25-

Standard InChI Key:  KOSHTGRKUOOEJW-YXFZHOHLSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  1  0  0  0  0  0999 V2000
   -0.9503    0.1755    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7956    0.1660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9416   -0.6897    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0474    0.1800    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7155    0.1952    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1434    0.1185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3712    0.8910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3590   -0.5379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5437    0.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3686    0.1679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8653    1.0121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1961    0.8839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1839   -0.5450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5345    1.4947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7872    0.8788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7750   -0.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1128    1.3503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0186    0.1538    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6122    0.8718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6000   -0.5571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4511    2.3154    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0295    2.1710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8436    0.1468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2870    1.1565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6986    2.6536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2622    0.8577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2499   -0.5712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0871    0.8506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0749   -0.5783    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4935    0.1326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3185    0.1256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  3  2  0
  1  4  1  0
  1 11  1  0
  7  4  1  1
  8  4  1  1
  5 12  1  0
  5 13  1  0
  6 31  3  0
  7  9  1  0
  7 12  1  0
  8  9  1  0
  8 13  1  0
  9 10  1  6
 10 15  2  0
 10 16  1  0
 11 14  1  0
 11 17  2  0
 14 21  2  0
 14 24  1  0
 15 19  1  0
 16 20  2  0
 17 22  1  0
 18 19  2  0
 18 20  1  0
 18 23  1  0
 21 25  1  0
 22 25  2  0
 23 26  2  0
 23 27  1  0
 26 28  1  0
 27 29  2  0
 28 30  2  0
 29 30  1  0
 30 31  1  0
M  END

Associated Targets(Human)

CASP6 Tchem Caspase-6 (1213 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 429.55Molecular Weight (Monoisotopic): 429.1511AlogP: 3.66#Rotatable Bonds: 4
Polar Surface Area: 73.20Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.79CX LogP: 4.13CX LogD: 3.59
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.69Np Likeness Score: -0.85

References

1. PubChem BioAssay data set, 

Source

Source(1):