SID131464104

ID: ALA3188710

PubChem CID: 54668591

Max Phase: Preclinical

Molecular Formula: C28H28N4O2

Molecular Weight: 452.56

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(c1ccncc1)N1CCCCN2[C@H](C1)[C@H](c1ccc(C#Cc3ccccn3)cc1)[C@@H]2CO

Standard InChI:  InChI=1S/C28H28N4O2/c33-20-26-27(22-9-6-21(7-10-22)8-11-24-5-1-2-14-30-24)25-19-31(17-3-4-18-32(25)26)28(34)23-12-15-29-16-13-23/h1-2,5-7,9-10,12-16,25-27,33H,3-4,17-20H2/t25-,26+,27+/m1/s1

Standard InChI Key:  AYDDHWHJBISHKO-PVHODMMVSA-N

Molfile:  

     RDKit          2D

 34 38  0  0  1  0  0  0  0  0999 V2000
    0.2135   -2.7886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9504    0.8699    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4084   -1.4084    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8167    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6258    2.7258    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7033    3.7137    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5834   -0.5834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4084   -0.5834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5834   -1.4084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9917    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9917   -1.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7969   -0.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2135    0.7969    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1324    0.7622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8167   -1.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4001   -0.5834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3803    0.3698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3698    1.3803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1667    1.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6302    1.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4001   -1.4084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7501    1.7501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8123    1.3090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9459    2.1789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3100    1.9635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4437    2.8334    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3335    2.3335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9168    2.9168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7137    2.7033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2867    4.2971    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2971    3.2867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0835    4.0835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1 13  1  0
  2 16  2  0
  8  3  1  1
  3  9  1  0
  3 12  1  0
  4 11  1  0
  4 16  1  0
  4 18  1  0
  5 27  2  0
  5 28  1  0
  6 30  1  0
  6 32  2  0
  7  8  1  0
  7  9  1  0
  7 10  1  1
  8 11  1  0
  9 13  1  1
 10 14  2  0
 10 15  1  0
 12 17  1  0
 14 19  1  0
 15 20  2  0
 16 22  1  0
 17 23  1  0
 18 23  1  0
 19 21  2  0
 20 21  1  0
 21 24  1  0
 22 25  2  0
 22 26  1  0
 24 29  3  0
 25 27  1  0
 26 28  2  0
 29 30  1  0
 30 31  2  0
 31 33  1  0
 32 34  1  0
 33 34  2  0
M  END

Associated Targets(Human)

CASP6 Tchem Caspase-6 (1213 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 452.56Molecular Weight (Monoisotopic): 452.2212AlogP: 2.94#Rotatable Bonds: 3
Polar Surface Area: 69.56Molecular Species: NEUTRALHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.39CX LogP: 2.70CX LogD: 1.66
Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.62Np Likeness Score: -0.73

References

1. PubChem BioAssay data set, 

Source

Source(1):