The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID125001398 ID: ALA3188772
PubChem CID: 53338856
Max Phase: Preclinical
Molecular Formula: C19H18F3N3O3S2
Molecular Weight: 343.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1sc2c(c1-c1nc3ccccc3s1)CCCNC2.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C17H17N3OS2.C2HF3O2/c1-10(21)19-16-15(11-5-4-8-18-9-14(11)23-16)17-20-12-6-2-3-7-13(12)22-17;3-2(4,5)1(6)7/h2-3,6-7,18H,4-5,8-9H2,1H3,(H,19,21);(H,6,7)
Standard InChI Key: WOIXORWSYBHURA-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
3.1278 1.9932 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
3.1281 3.1930 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.1672 3.7928 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.5066 2.4425 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.4672 0.6428 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1672 2.5928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4672 1.8428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2919 -1.4230 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.9376 3.5509 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-8.5840 -1.6068 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.2507 2.8867 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.6628 -0.2636 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.3541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.3608 0.9869 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9378 0.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8786 2.3955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1640 -0.2295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8689 -0.9181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7682 4.7919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2051 4.3793 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7902 1.5836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6754 -1.7673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.3894 6.2475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2984 5.4122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3213 1.2853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.3844 -1.5796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4877 7.2978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.9247 6.8852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3672 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7613 -2.6052 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 6 1 0
2 6 1 0
3 6 1 0
4 7 2 0
5 7 1 0
6 7 1 0
8 17 1 0
8 18 1 0
9 16 1 0
9 19 1 0
10 26 2 0
11 16 2 0
11 20 1 0
12 17 1 0
12 26 1 0
13 22 1 0
13 29 1 0
14 15 1 0
14 16 1 0
14 17 2 0
15 18 2 0
15 21 1 0
18 22 1 0
19 20 1 0
19 23 2 0
20 24 2 0
21 25 1 0
23 27 1 0
24 28 1 0
25 29 1 0
26 30 1 0
27 28 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 343.48Molecular Weight (Monoisotopic): 343.0813AlogP: 4.02#Rotatable Bonds: 2Polar Surface Area: 54.02Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.58CX Basic pKa: 8.91CX LogP: 3.37CX LogD: 1.97Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.74Np Likeness Score: -1.92
References 1. PubChem BioAssay data set,