The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID144089633 ID: ALA3188921
PubChem CID: 60156649
Max Phase: Preclinical
Molecular Formula: C20H24N2O8S
Molecular Weight: 452.49
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)C(C(=O)OC)[C@H]1C=C[C@@H](C(=O)NS(=O)(=O)c2ccc(C)cc2)N(C(C)=O)C1
Standard InChI: InChI=1S/C20H24N2O8S/c1-12-5-8-15(9-6-12)31(27,28)21-18(24)16-10-7-14(11-22(16)13(2)23)17(19(25)29-3)20(26)30-4/h5-10,14,16-17H,11H2,1-4H3,(H,21,24)/t14-,16-/m0/s1
Standard InChI Key: HBKUTRXJNHFYCR-HOCLYGCPSA-N
Molfile:
RDKit 2D
31 32 0 0 1 0 0 0 0 0999 V2000
-3.8933 3.7570 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.8956 2.5570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9336 3.1588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6375 0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.1972 -1.5121 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0432 3.5994 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5548 -3.6021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9040 0.4424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 3.0039 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5973 1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8912 5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8999 -0.7576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5911 6.0060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1892 6.0096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5890 7.5060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1871 7.5096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8870 8.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0351 3.6026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8853 9.4578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8916 -4.9570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2387 -0.9161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 3 2 0
1 11 1 0
1 17 1 0
4 14 2 0
5 21 1 0
5 30 1 0
6 22 1 0
6 31 1 0
7 20 2 0
8 21 2 0
9 22 2 0
10 12 1 0
10 16 1 0
10 20 1 0
11 14 1 0
12 14 1 1
12 18 1 0
13 15 1 1
13 16 1 0
13 19 1 0
15 21 1 0
15 22 1 0
17 23 2 0
17 24 1 0
18 19 2 0
20 28 1 0
23 25 1 0
24 26 2 0
25 27 2 0
26 27 1 0
27 29 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.49Molecular Weight (Monoisotopic): 452.1253AlogP: 0.17#Rotatable Bonds: 6Polar Surface Area: 136.15Molecular Species: ACIDHBA: 8HBD: 1#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.99CX Basic pKa: ┄CX LogP: 0.57CX LogD: -0.37Aromatic Rings: 1Heavy Atoms: 31QED Weighted: 0.37Np Likeness Score: -0.32
References 1. PubChem BioAssay data set,