The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID143471982 ID: ALA3188964
PubChem CID: 60138097
Max Phase: Preclinical
Molecular Formula: C19H18F3N3O3S2
Molecular Weight: 343.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)Nc1sc2c(c1-c1nc3ccccc3s1)CCN(C)C2.O=C(O)C(F)(F)F
Standard InChI: InChI=1S/C17H17N3OS2.C2HF3O2/c1-10(21)18-16-15(11-7-8-20(2)9-14(11)23-16)17-19-12-5-3-4-6-13(12)22-17;3-2(4,5)1(6)7/h3-6H,7-9H2,1-2H3,(H,18,21);(H,6,7)
Standard InChI Key: CRVFDTGFVDMVPX-UHFFFAOYSA-N
Molfile:
RDKit 2D
30 32 0 0 0 0 0 0 0 0999 V2000
12.4609 -2.1664 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
12.4607 -3.3662 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
11.4215 -3.9660 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.0821 -2.6157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1215 -0.8160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4215 -2.7660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1215 -2.0160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.6398 -2.9511 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
6.0207 1.3637 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4133 -3.8646 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0872 0.0382 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1852 -2.6281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7579 -4.4398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3748 -5.0072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9577 -5.3467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1577 -6.4955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8208 1.3475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7475 -6.8518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3644 -7.4193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3560 1.3452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2072 2.3788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 6 1 0
2 6 1 0
3 6 1 0
4 7 2 0
5 7 1 0
6 7 1 0
8 17 1 0
8 18 1 0
9 16 1 0
9 19 1 0
10 26 2 0
11 16 2 0
11 20 1 0
12 17 1 0
12 26 1 0
13 22 1 0
13 23 1 0
13 29 1 0
14 15 1 0
14 16 1 0
14 17 2 0
15 18 2 0
15 21 1 0
18 22 1 0
19 20 1 0
19 24 2 0
20 25 2 0
21 23 1 0
24 27 1 0
25 28 1 0
26 30 1 0
27 28 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 343.48Molecular Weight (Monoisotopic): 343.0813AlogP: 3.97#Rotatable Bonds: 2Polar Surface Area: 45.23Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.57CX Basic pKa: 7.07CX LogP: 3.44CX LogD: 3.27Aromatic Rings: 3Heavy Atoms: 23QED Weighted: 0.77Np Likeness Score: -2.07
References 1. PubChem BioAssay data set,