The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(4-{4-[2-(2,4-Dichloro-phenyl)-2-imidazol-1-ylmethyl-[1,3]dioxolan-4-ylmethoxy]-phenyl}-piperazin-1-yl)-ethanone ID: ALA319160
Cas Number: 79156-75-5
PubChem CID: 638701
Product Number: S607141, Order Now?
Max Phase: Preclinical
Molecular Formula: C26H28Cl2N4O4
Molecular Weight: 531.44
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N1CCN(c2ccc(OC[C@H]3CO[C@@](Cn4ccnc4)(c4ccc(Cl)cc4Cl)O3)cc2)CC1
Standard InChI: InChI=1S/C26H28Cl2N4O4/c1-19(33)31-10-12-32(13-11-31)21-3-5-22(6-4-21)34-15-23-16-35-26(36-23,17-30-9-8-29-18-30)24-7-2-20(27)14-25(24)28/h2-9,14,18,23H,10-13,15-17H2,1H3/t23-,26+/m0/s1
Standard InChI Key: XMAYWYJOQHXEEK-JYFHCDHNSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
-2.9271 -2.4575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.5946 -2.9424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3396 -3.7270 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5146 -3.7270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2597 -2.9424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9271 -1.6325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2127 -1.2200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5996 -0.6680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.8851 -1.0805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0566 -1.8874 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8771 -1.9737 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.6976 -0.5526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5181 -0.6388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0030 0.0286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6674 0.7823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8470 0.8686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3620 0.2011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.1524 1.4498 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.1314 -0.7449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0452 0.0756 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7085 0.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7947 1.2316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5484 1.5672 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2158 1.0823 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1296 0.2618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3759 -0.0738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9695 1.4178 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6370 0.9329 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3906 1.2684 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4769 2.0889 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8094 2.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0557 2.2383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2305 2.4245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3168 3.2450 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.8980 1.9396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8536 -1.3925 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
5 1 1 0
6 1 1 0
2 3 2 0
4 3 1 0
4 5 2 0
7 6 1 6
7 8 1 0
7 11 1 0
7 12 1 1
9 8 1 0
9 10 1 0
9 19 1 1
10 11 1 0
12 13 2 0
17 12 1 0
14 13 1 0
13 36 1 0
14 15 2 0
15 16 1 0
15 18 1 0
16 17 2 0
19 20 1 0
21 20 1 0
21 22 2 0
21 26 1 0
22 23 1 0
23 24 2 0
24 25 1 0
24 27 1 0
25 26 2 0
28 27 1 0
32 27 1 0
28 29 1 0
29 30 1 0
31 30 1 0
33 30 1 0
31 32 1 0
33 34 2 0
33 35 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 531.44Molecular Weight (Monoisotopic): 530.1488AlogP: 4.21#Rotatable Bonds: 7Polar Surface Area: 69.06Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 6.42CX LogP: 4.19CX LogD: 4.16Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.46Np Likeness Score: -0.77
References 1. Rotstein DM, Kertesz DJ, Walker KA, Swinney DC.. (1992) Stereoisomers of ketoconazole: preparation and biological activity., 35 (15): [PMID:1495014 ] [10.1021/jm00093a015 ]