The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID26658451 ID: ALA3198807
PubChem CID: 6891043
Max Phase: Preclinical
Molecular Formula: C24H23N3O7S
Molecular Weight: 497.53
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(S(=O)(=O)N(CC(=O)N/N=C/c2ccccc2C(=O)O)c2ccccc2OC)cc1
Standard InChI: InChI=1S/C24H23N3O7S/c1-33-18-11-13-19(14-12-18)35(31,32)27(21-9-5-6-10-22(21)34-2)16-23(28)26-25-15-17-7-3-4-8-20(17)24(29)30/h3-15H,16H2,1-2H3,(H,26,28)(H,29,30)/b25-15+
Standard InChI Key: FCEXQKOHNFCCEF-MFKUBSTISA-N
Molfile:
RDKit 2D
35 37 0 0 1 0 0 0 0 0999 V2000
-2.5988 1.5004 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.6378 0.9001 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6383 2.0999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5960 6.0066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.0346 5.7527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.1398 10.3639 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-9.1060 8.5609 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5998 3.0012 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2002 6.0029 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2012 7.5037 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3003 3.7520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2986 5.2521 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8995 3.7516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0019 3.0007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9005 5.2525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0012 6.0007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2979 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2994 5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5019 9.7549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7999 10.5068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5009 8.2541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5930 7.2066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1022 9.7609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2018 10.5032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7978 12.0068 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1997 12.0032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4977 12.7550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5956 -2.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
1 3 2 0
1 9 1 0
1 13 1 0
4 14 1 0
4 29 1 0
5 21 1 0
5 35 1 0
6 19 2 0
7 30 2 0
8 30 1 0
9 12 1 0
9 15 1 0
10 11 1 0
10 19 1 0
11 28 2 0
12 14 1 0
12 18 2 0
13 16 2 0
13 17 1 0
14 20 2 0
15 19 1 0
16 22 1 0
17 23 2 0
18 24 1 0
20 25 1 0
21 22 2 0
21 23 1 0
24 25 2 0
26 27 1 0
26 28 1 0
26 31 2 0
27 30 1 0
27 32 2 0
31 33 1 0
32 34 1 0
33 34 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 497.53Molecular Weight (Monoisotopic): 497.1257AlogP: 2.75#Rotatable Bonds: 10Polar Surface Area: 134.60Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.47CX Basic pKa: 0.59CX LogP: 2.84CX LogD: -0.55Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.32Np Likeness Score: -1.58
References 1. PubChem BioAssay data set,