The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[(S)-4-Guanidino-1-({[4-guanidino-1-(4-nitro-phenylcarbamoyl)-butylcarbamoyl]-methyl}-carbamoyl)-butyl]-carbamic acid benzyl ester ID: ALA32044
PubChem CID: 44287771
Max Phase: Preclinical
Molecular Formula: C28H39N11O7
Molecular Weight: 641.69
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: N=C(N)NCCCC(NC(=O)CNC(=O)[C@H](CCCN=C(N)N)NC(=O)OCc1ccccc1)C(=O)Nc1ccc([N+](=O)[O-])cc1
Standard InChI: InChI=1S/C28H39N11O7/c29-26(30)33-14-4-8-21(38-28(43)46-17-18-6-2-1-3-7-18)24(41)35-16-23(40)37-22(9-5-15-34-27(31)32)25(42)36-19-10-12-20(13-11-19)39(44)45/h1-3,6-7,10-13,21-22H,4-5,8-9,14-17H2,(H,35,41)(H,36,42)(H,37,40)(H,38,43)(H4,29,30,33)(H4,31,32,34)/t21-,22?/m0/s1
Standard InChI Key: WIQWZMXJFYDPOU-HMTLIYDFSA-N
Molfile:
RDKit 2D
46 47 0 0 1 0 0 0 0 0999 V2000
11.0167 1.3333 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4417 0.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0125 -0.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1542 0.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0125 -3.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1542 -3.6167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7292 0.0958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1542 -0.3167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.0167 0.0958 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3000 0.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3000 -0.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8667 -0.3167 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.7292 0.9208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7292 -0.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4417 -0.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0125 2.1583 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3000 -4.0292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4417 -4.0292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.4417 0.9208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0167 -1.1417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1542 0.9208 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3000 0.0958 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.3000 -1.1417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0125 -2.7917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.1542 -2.7917 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5875 0.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5792 1.3333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3000 0.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8750 0.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7292 -4.0292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.8750 -4.0292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4208 -0.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8667 0.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5875 -0.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1333 0.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7292 -1.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4417 -1.1417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7292 -2.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4417 -2.3792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1208 0.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8458 -0.3167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4417 -1.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7292 -1.5542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5500 0.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8458 1.3333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5500 0.9208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 8 1 0
3 7 1 0
4 12 1 0
5 24 2 0
6 25 1 0
7 15 1 0
8 29 1 0
9 14 1 0
10 1 1 0
11 9 1 0
12 26 1 0
13 1 1 0
14 2 1 0
15 4 1 0
16 1 2 0
17 5 1 0
18 6 2 0
19 2 2 0
20 3 2 0
21 4 2 0
22 3 1 0
23 11 2 0
24 38 1 0
25 39 1 0
26 11 1 0
27 10 2 0
28 10 1 0
29 34 1 0
30 5 1 0
31 6 1 0
32 22 1 0
33 27 1 0
34 28 2 0
35 32 1 0
36 14 1 0
15 37 1 6
38 43 1 0
39 42 1 0
40 35 2 0
41 35 1 0
42 36 1 0
43 37 1 0
44 41 2 0
45 40 1 0
46 44 1 0
33 29 2 0
45 46 2 0
M CHG 2 1 1 13 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 641.69Molecular Weight (Monoisotopic): 641.3034AlogP: -0.25#Rotatable Bonds: 18Polar Surface Area: 295.07Molecular Species: BASEHBA: 9HBD: 9#RO5 Violations: 2HBA (Lipinski): 18HBD (Lipinski): 12#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.69CX Basic pKa: 11.52CX LogP: -1.09CX LogD: -5.35Aromatic Rings: 2Heavy Atoms: 46QED Weighted: 0.03Np Likeness Score: -0.41
References 1. Marlowe CK, Sinha U, Gunn AC, Scarborough RM.. (2000) Design, synthesis and structure-activity relationship of a series of arginine aldehyde factor Xa inhibitors. Part 1: structures based on the (D)-Arg-Gly-Arg tripeptide sequence., 10 (1): [PMID:10636232 ] [10.1016/s0960-894x(99)00582-x ]