(S)-2-[3-(4-Cyano-benzoylamino)-2,2-dimethyl-nonanoylamino]-3-phenyl-propionic acid tert-butyl ester

ID: ALA320712

PubChem CID: 10792394

Max Phase: Preclinical

Molecular Formula: C32H43N3O4

Molecular Weight: 533.71

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCCCCCC(NC(=O)c1ccc(C#N)cc1)C(C)(C)C(=O)N[C@@H](Cc1ccccc1)C(=O)OC(C)(C)C

Standard InChI:  InChI=1S/C32H43N3O4/c1-7-8-9-13-16-27(35-28(36)25-19-17-24(22-33)18-20-25)32(5,6)30(38)34-26(29(37)39-31(2,3)4)21-23-14-11-10-12-15-23/h10-12,14-15,17-20,26-27H,7-9,13,16,21H2,1-6H3,(H,34,38)(H,35,36)/t26-,27?/m0/s1

Standard InChI Key:  MSQSBKNKTFHCCN-QBHOUYDASA-N

Molfile:  

     RDKit          2D

 39 40  0  0  1  0  0  0  0  0999 V2000
    7.1917   -4.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4792   -5.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3417   -5.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9042   -5.4000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.3292   -5.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0542   -5.4042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.6167   -4.9875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7667   -4.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7792   -7.0750    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0417   -4.9750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4917   -6.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6292   -5.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1917   -4.1625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.3417   -4.1750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3292   -6.2167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6167   -4.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7542   -5.3875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9167   -5.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6417   -6.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2042   -6.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0667   -6.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8917   -6.1125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9292   -6.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2042   -5.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3292   -3.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7667   -4.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4667   -5.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1667   -4.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3417   -6.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3292   -2.9250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0417   -4.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0542   -3.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3417   -1.6917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3417   -2.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0542   -2.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6292   -1.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0292   -2.5042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7542   -3.7417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7542   -2.9167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  6  1  0
  4  1  1  0
  5  7  1  0
  6  8  1  0
  7  4  1  0
  8  2  1  0
  9 11  3  0
 10  5  1  0
 11 20  1  0
 12  3  1  0
 13  1  2  0
 14  3  2  0
 15  5  2  0
  7 16  1  1
 17 10  1  0
 18 12  2  0
 19 12  1  0
 20 23  1  0
 21  2  1  0
 22  2  1  0
 23 19  2  0
 24 18  1  0
 25 16  1  0
 26  8  1  0
 27 17  1  0
 28 17  1  0
 29 17  1  0
 30 25  1  0
 31 25  2  0
 32 26  1  0
 33 34  1  0
 34 35  1  0
 35 32  1  0
 36 33  1  0
 37 30  2  0
 38 31  1  0
 39 38  2  0
 37 39  1  0
 20 24  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA320712

   (S)-2-[3-(4-Cyano-benzoylamino)-2,2-dimethyl-nonanoylamino]-3-phenyl-propionic acid tert-butyl ester

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 533.71

Molecular Weight (Monoisotopic): 533.3254

AlogP: 5.72

#Rotatable Bonds: 13

Polar Surface Area: 108.29

Molecular Species: NEUTRAL

HBA: 5

HBD: 2

#RO5 Violations: 2

HBA (Lipinski): 7

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 12.30

CX Basic pKa: ┄

CX LogP: 6.75

CX LogD: 6.75

Aromatic Rings: 2

Heavy Atoms: 39

QED Weighted: 0.25

Np Likeness Score: -0.42

References

1. Iijima K, Katada J, Yasuda E, Uno I, Hayashi Y..  (1999)  N-[2,2-dimethyl-3-(N-(4-cyanobenzoyl)amino)nonanoyl]-L-phenylalanine ethyl ester as a stable ester-type inhibitor of chymotrypsin-like serine proteases: structural requirements for potent inhibition of alpha-chymotrypsin.,  42  (2): [PMID:9925737] [10.1021/jm980562h]

Source

Source(1):

• Scientific Literature