The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID47196069 ID: ALA3207912
PubChem CID: 6873522
Max Phase: Preclinical
Molecular Formula: C27H25N3O5
Molecular Weight: 471.51
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2cc(C(=O)N/N=C/c3cc(OC)c(OC)cc3OC)c3ccccc3n2)cc1
Standard InChI: InChI=1S/C27H25N3O5/c1-32-19-11-9-17(10-12-19)23-14-21(20-7-5-6-8-22(20)29-23)27(31)30-28-16-18-13-25(34-3)26(35-4)15-24(18)33-2/h5-16H,1-4H3,(H,30,31)/b28-16+
Standard InChI Key: CEUZLYKWOYURFG-LQKURTRISA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-0.2489 -3.5938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.4720 -7.5301 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2536 -10.4947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8481 -12.0132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.8096 3.7478 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 -3.7544 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5812 -5.2552 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 -2.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9086 1.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8717 -7.5123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1663 -8.2701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5594 -9.7547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8539 -10.5124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5682 -8.2547 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1574 -9.7701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9097 3.0028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2071 0.7519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8775 -6.0115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5078 3.0010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2092 3.7519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5067 1.5010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5068 -8.1378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2189 -9.8871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.8847 -12.6178 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8475 3.1456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 14 2 0
2 19 1 0
2 32 1 0
3 20 1 0
3 33 1 0
4 21 1 0
4 34 1 0
5 29 1 0
5 35 1 0
6 11 2 0
6 12 1 0
7 8 1 0
7 14 1 0
8 28 2 0
9 10 2 0
9 11 1 0
9 16 1 0
10 13 1 0
10 14 1 0
11 18 1 0
12 13 2 0
12 15 1 0
15 24 2 0
15 25 1 0
16 26 2 0
17 19 1 0
17 22 2 0
17 28 1 0
18 27 2 0
19 23 2 0
20 21 2 0
20 22 1 0
21 23 1 0
24 30 1 0
25 31 2 0
26 27 1 0
29 30 2 0
29 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 471.51Molecular Weight (Monoisotopic): 471.1794AlogP: 4.70#Rotatable Bonds: 8Polar Surface Area: 91.27Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.03CX Basic pKa: 1.98CX LogP: 4.52CX LogD: 4.52Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.30Np Likeness Score: -1.16
References 1. PubChem BioAssay data set,