The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID22414949 ID: ALA3212159
PubChem CID: 9563829
Max Phase: Preclinical
Molecular Formula: C26H29N3O4
Molecular Weight: 447.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(/C=N/NC(=O)c2cc3ccccc3cc2O)ccc1OCCN1CCCCC1
Standard InChI: InChI=1S/C26H29N3O4/c1-32-25-15-19(9-10-24(25)33-14-13-29-11-5-2-6-12-29)18-27-28-26(31)22-16-20-7-3-4-8-21(20)17-23(22)30/h3-4,7-10,15-18,30H,2,5-6,11-14H2,1H3,(H,28,31)/b27-18+
Standard InChI Key: NPYRKPWGQDDCRN-OVVQPSECSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-3.6486 -1.3517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-10.3998 8.2584 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9494 0.9039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.7961 9.7611 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9067 3.0027 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.2049 3.7560 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-14.2985 7.5022 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9091 1.5019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7994 8.2603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0986 7.5105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5006 6.0101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5005 7.5101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0988 6.0105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7999 5.2603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2025 5.2568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.6985 7.5064 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.9997 8.2543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7559 10.3595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.6001 8.2479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-14.2936 6.0022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.8967 7.4936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-15.5902 5.2479 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-16.8917 5.9936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 11 1 0
2 18 1 0
2 26 1 0
3 14 2 0
4 17 1 0
4 28 1 0
5 6 1 0
5 14 1 0
6 25 2 0
7 27 1 0
7 29 1 0
7 30 1 0
8 11 1 0
8 12 2 0
8 14 1 0
9 10 1 0
9 12 1 0
9 15 2 0
10 13 1 0
10 16 2 0
11 13 2 0
15 21 1 0
16 22 1 0
17 18 1 0
17 20 2 0
18 23 2 0
19 20 1 0
19 24 2 0
19 25 1 0
21 22 2 0
23 24 1 0
26 27 1 0
29 31 1 0
30 32 1 0
31 33 1 0
32 33 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 447.54Molecular Weight (Monoisotopic): 447.2158AlogP: 4.18#Rotatable Bonds: 8Polar Surface Area: 83.39Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.71CX Basic pKa: 8.51CX LogP: 3.97CX LogD: 3.74Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.40Np Likeness Score: -1.12
References 1. PubChem BioAssay data set,