The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID17510034 ID: ALA3212807
PubChem CID: 46495962
Max Phase: Preclinical
Molecular Formula: C26H21N3O4
Molecular Weight: 439.47
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CNc1cccc2ccccc12)N/N=C/c1ccc(OC(=O)/C=C/c2ccco2)cc1
Standard InChI: InChI=1S/C26H21N3O4/c30-25(18-27-24-9-3-6-20-5-1-2-8-23(20)24)29-28-17-19-10-12-22(13-11-19)33-26(31)15-14-21-7-4-16-32-21/h1-17,27H,18H2,(H,29,30)/b15-14+,28-17+
Standard InChI Key: NCONQZSJSJJAMU-MVUNRXBLSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
-5.1325 14.2702 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2795 19.6061 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5395 5.8509 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7926 14.4031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 2.9981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8775 6.0115 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8717 7.5123 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1444 12.7695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1622 9.7694 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 3.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4479 12.0272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8499 12.0118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5812 5.2552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4568 10.5272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8587 10.5118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8272 15.0111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1681 8.2686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4981 18.7535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8153 16.5119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5100 17.2527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7065 19.6205 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7345 21.0354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2345 21.0443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 18 1 0
1 26 1 0
2 28 1 0
2 32 1 0
3 23 2 0
4 26 2 0
5 10 1 0
5 20 1 0
6 7 1 0
6 23 1 0
7 27 2 0
8 9 1 0
8 10 1 0
8 11 2 0
9 12 1 0
9 14 2 0
10 13 2 0
11 16 1 0
12 15 2 0
13 15 1 0
14 17 1 0
16 17 2 0
18 21 2 0
18 22 1 0
19 24 2 0
19 25 1 0
19 27 1 0
20 23 1 0
21 24 1 0
22 25 2 0
26 29 1 0
28 30 1 0
28 31 2 0
29 30 2 0
31 33 1 0
32 33 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.47Molecular Weight (Monoisotopic): 439.1532AlogP: 4.61#Rotatable Bonds: 8Polar Surface Area: 92.93Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.70CX Basic pKa: 2.06CX LogP: 4.51CX LogD: 4.51Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.14Np Likeness Score: -1.36
References 1. PubChem BioAssay data set,