The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24779180 ID: ALA3213490
Cas Number: 851716-78-4
PubChem CID: 4155348
Max Phase: Preclinical
Molecular Formula: C20H20N4O7S2
Molecular Weight: 492.54
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)Cn1/c(=N/C(=O)CSCC(=O)Nc2cc(C)on2)sc2cc(C(=O)OC)ccc21
Standard InChI: InChI=1S/C20H20N4O7S2/c1-11-6-15(23-31-11)21-16(25)9-32-10-17(26)22-20-24(8-18(27)29-2)13-5-4-12(19(28)30-3)7-14(13)33-20/h4-7H,8-10H2,1-3H3,(H,21,23,25)/b22-20-
Standard InChI Key: ZLZGRONSTQOTRF-XDOYNYLZSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
1.7138 1.2033 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.0552 2.6770 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-4.9153 0.7255 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.1277 -4.3539 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6319 2.6865 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4530 -2.0330 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2072 2.3788 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9825 7.6982 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.6760 5.0377 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0872 0.0382 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7903 4.0267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.8828 6.6780 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1855 -2.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6217 1.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6552 -2.9294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8208 1.3475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3215 1.3677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5239 5.3360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2926 6.9676 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0026 5.4959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2896 4.0065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5559 2.6972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9598 1.3162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3028 -4.5970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3814 7.4719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 15 1 0
1 16 1 0
2 25 1 0
2 30 1 0
3 22 1 0
3 31 1 0
4 23 1 0
4 32 1 0
5 22 2 0
6 23 2 0
7 24 2 0
8 13 1 0
8 27 1 0
9 29 2 0
10 14 1 0
10 16 1 0
10 20 1 0
11 16 2 0
11 24 1 0
12 26 1 0
12 29 1 0
13 26 2 0
14 15 1 0
14 18 2 0
15 17 2 0
17 19 1 0
18 21 1 0
19 21 2 0
19 22 1 0
20 23 1 0
24 25 1 0
26 28 1 0
27 28 2 0
27 33 1 0
29 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.54Molecular Weight (Monoisotopic): 492.0773AlogP: 1.76#Rotatable Bonds: 8Polar Surface Area: 142.09Molecular Species: NEUTRALHBA: 11HBD: 1#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.92CX Basic pKa: ┄CX LogP: 1.56CX LogD: 1.55Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.47Np Likeness Score: -2.61
References 1. PubChem BioAssay data set,