The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID24795799 ID: ALA3213629
PubChem CID: 2936328
Max Phase: Preclinical
Molecular Formula: C23H25N3O4S
Molecular Weight: 439.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1ccc(/N=C2\SC(C(=O)NCCc3ccccc3)CC(=O)N2C)cc1
Standard InChI: InChI=1S/C23H25N3O4S/c1-3-30-22(29)17-9-11-18(12-10-17)25-23-26(2)20(27)15-19(31-23)21(28)24-14-13-16-7-5-4-6-8-16/h4-12,19H,3,13-15H2,1-2H3,(H,24,28)/b25-23-
Standard InChI Key: FCJYLVGFQLVFCN-BZZOAKBMSA-N
Molfile:
RDKit 2D
31 33 0 0 1 0 0 0 0 0999 V2000
-3.8939 -0.7546 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-7.5385 1.3328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.1480 -3.6081 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6375 -0.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2007 1.4909 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4865 -3.7630 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1903 -1.5091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4972 0.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4920 -0.7636 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1882 -3.0099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2049 2.6909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4844 -5.2638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7826 -6.0169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7805 -7.5177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8933 -3.7570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0769 -8.2722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4789 -8.2633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0718 -9.7722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4737 -9.7633 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7702 -10.5177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8916 -4.9570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 9 1 0
1 10 1 0
2 11 2 0
3 14 2 0
4 21 1 0
4 25 1 0
5 21 2 0
6 9 1 0
6 11 1 0
6 18 1 0
7 9 2 0
7 13 1 0
8 14 1 0
8 22 1 0
10 12 1 0
10 14 1 0
11 12 1 0
13 16 2 0
13 17 1 0
15 19 2 0
15 20 1 0
15 21 1 0
16 19 1 0
17 20 2 0
22 23 1 0
23 24 1 0
24 26 2 0
24 27 1 0
25 31 1 0
26 28 1 0
27 29 2 0
28 30 2 0
29 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 439.54Molecular Weight (Monoisotopic): 439.1566AlogP: 3.17#Rotatable Bonds: 7Polar Surface Area: 88.07Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 2.59CX LogP: 3.72CX LogD: 3.72Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.67Np Likeness Score: -1.06
References 1. PubChem BioAssay data set,