The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID17411606 ID: ALA3213802
PubChem CID: 1051573
Max Phase: Preclinical
Molecular Formula: C24H24N6O4S
Molecular Weight: 492.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1nccnc1NS(=O)(=O)c1ccc(/N=C/c2c(C)nn(-c3ccc(C)c(C)c3)c2O)cc1
Standard InChI: InChI=1S/C24H24N6O4S/c1-15-5-8-19(13-16(15)2)30-24(31)21(17(3)28-30)14-27-18-6-9-20(10-7-18)35(32,33)29-22-23(34-4)26-12-11-25-22/h5-14,31H,1-4H3,(H,25,29)/b27-14+
Standard InChI Key: NPMQQPZLEBASQD-MZJWZYIUSA-N
Molfile:
RDKit 2D
35 38 0 0 0 0 0 0 0 0999 V2000
-1.3039 -3.7494 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.2763 -12.4848 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3421 -3.1476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3020 -2.5494 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8826 -14.2857 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.3826 -14.2826 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 -3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3193 -9.7510 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4161 -12.8601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6279 -11.9977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8431 -12.8551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0030 -15.5016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 -5.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6217 -10.4969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4742 -15.2311 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3132 -8.2502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5103 -16.9080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0095 -6.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6076 -5.9975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4423 -16.3769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0126 -7.5029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6106 -7.4975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9341 -17.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5422 -18.0537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9814 -12.4751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6234 -16.1644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7086 -18.7047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6387 -0.8963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 3 2 0
1 4 2 0
1 8 1 0
1 16 1 0
2 12 1 0
5 25 1 0
5 35 1 0
6 7 1 0
6 12 1 0
6 15 1 0
7 14 2 0
8 18 1 0
9 17 2 0
9 20 1 0
10 18 2 0
10 31 1 0
11 25 2 0
11 32 1 0
12 13 2 0
13 14 1 0
13 17 1 0
14 30 1 0
15 19 1 0
15 21 2 0
16 22 2 0
16 23 1 0
18 25 1 0
19 24 2 0
20 26 2 0
20 27 1 0
21 29 1 0
22 26 1 0
23 27 2 0
24 28 1 0
24 33 1 0
28 29 2 0
28 34 1 0
31 32 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.56Molecular Weight (Monoisotopic): 492.1580AlogP: 3.85#Rotatable Bonds: 7Polar Surface Area: 131.59Molecular Species: ACIDHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 5.07CX Basic pKa: 2.27CX LogP: 3.96CX LogD: 1.57Aromatic Rings: 4Heavy Atoms: 35QED Weighted: 0.37Np Likeness Score: -1.92
References 1. PubChem BioAssay data set,