The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-[6-(4,5-Dihydroxy-2-hydroxymethyl-6-methoxy-tetrahydro-pyran-3-yloxy)-3,4,5-trihydroxy-tetrahydro-pyran-2-ylmethylsulfanyl]-butyrate; compound with sodium ID: ALA3215327
PubChem CID: 90664043
Max Phase: Preclinical
Molecular Formula: C17H29NaO12S
Molecular Weight: 458.48
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCC(SC[C@@H]1O[C@@H](O[C@H]2[C@H](O)[C@H](O)[C@H](OC)O[C@H]2CO)[C@@H](O)[C@@H](O)[C@H]1O)C(=O)[O-].[Na+]
Standard InChI: InChI=1S/C17H30O12S.Na/c1-3-8(15(24)25)30-5-7-9(19)10(20)12(22)17(28-7)29-14-6(4-18)27-16(26-2)13(23)11(14)21;/h6-14,16-23H,3-5H2,1-2H3,(H,24,25);/q;+1/p-1/t6-,7-,8?,9-,10-,11+,12-,13-,14+,16+,17-;/m0./s1
Standard InChI Key: SDCMZALLIASHKB-LDXYOQADSA-M
Molfile:
RDKit 2D
31 31 0 0 0 0 0 0 0 0999 V2000
4.7161 0.0000 0.0000 Na 0 0 0 0 0 15 0 0 0 0 0 0
-1.0955 0.3850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3811 1.6225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8100 -0.0275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3334 1.2100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0479 1.6225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8100 -0.8525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3811 -0.0275 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0955 1.2100 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3334 2.8600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0479 2.4475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0955 -1.2650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3811 -0.8525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3811 2.4475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0479 -3.3275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3334 -2.0900 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.3334 -1.2650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7624 -3.7400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0479 -2.5025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5245 0.3850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7624 1.2100 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3334 0.3850 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5245 -1.2650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0955 -2.0900 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7624 2.8600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3334 -3.7400 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0955 2.8600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8100 2.4475 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7624 -2.0900 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7624 3.6850 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4768 -2.5025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3 9 1 6
4 2 1 0
5 3 1 0
6 5 1 0
7 4 1 0
8 2 1 0
2 9 1 6
10 14 1 0
11 10 1 0
12 13 1 0
13 8 1 0
14 3 1 0
15 19 1 0
16 17 1 0
13 17 1 1
18 15 2 0
19 16 1 0
4 20 1 6
6 21 1 1
5 22 1 1
7 23 1 6
12 24 1 6
11 25 1 1
26 15 1 0
14 27 1 6
28 27 1 0
29 19 1 0
30 25 1 0
31 29 1 0
12 7 1 0
6 11 1 0
M CHG 2 1 1 26 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.48Molecular Weight (Monoisotopic): 458.1458AlogP: -3.14#Rotatable Bonds: 9Polar Surface Area: 195.60Molecular Species: ACIDHBA: 12HBD: 7#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 7#RO5 Violations (Lipinski): 2CX Acidic pKa: 3.78CX Basic pKa: ┄CX LogP: -2.32CX LogD: -5.59Aromatic Rings: ┄Heavy Atoms: 30QED Weighted: 0.18Np Likeness Score: 1.45
References 1. Fazli A, Bradley SJ, Kiefel MJ, Jolly C, Holmes IH, von Itzstein M.. (2001) Synthesis and biological evaluation of sialylmimetics as rotavirus inhibitors., 44 (20): [PMID:11563928 ] [10.1021/jm0100887 ]