The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-Amino-2,6-diisopropylphenyl)-N'-{[4-(3-methoxyphenyl)-1-pyridin-3-ylpiperidin-4-yl]methyl}urea dihydrochloride ID: ALA3215788
PubChem CID: 90664416
Max Phase: Preclinical
Molecular Formula: C31H43Cl2N5O2
Molecular Weight: 515.70
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(C2(CNC(=O)Nc3c(C(C)C)cc(N)cc3C(C)C)CCN(c3cccnc3)CC2)c1.Cl.Cl
Standard InChI: InChI=1S/C31H41N5O2.2ClH/c1-21(2)27-17-24(32)18-28(22(3)4)29(27)35-30(37)34-20-31(23-8-6-10-26(16-23)38-5)11-14-36(15-12-31)25-9-7-13-33-19-25;;/h6-10,13,16-19,21-22H,11-12,14-15,20,32H2,1-5H3,(H2,34,35,37);2*1H
Standard InChI Key: STGZSJMNQNLELX-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 41 0 0 0 0 0 0 0 0999 V2000
11.5836 -4.1316 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.1597 -1.5281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1622 -0.0281 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8644 0.7241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5641 -0.0238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5978 -1.5030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8594 -2.2759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4631 0.7201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4633 2.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7624 2.9701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0614 2.2200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0613 0.7200 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7622 -0.0299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5955 -3.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8937 -3.7570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8914 -5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1896 -6.0110 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1873 -7.5118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4837 -8.2665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4784 -9.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1767 -10.5119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8803 -9.7573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8856 -8.2573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5869 -7.5050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5465 -8.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5890 -6.3050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7876 -7.5234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8239 -8.1286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8511 -5.8559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7940 -6.3234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0432 3.5994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1724 -11.7119 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.0836 -4.1316 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
20 14 1 0
10 11 2 0
15 21 1 0
4 5 1 0
21 22 1 0
11 12 1 0
22 23 1 0
5 6 1 0
23 24 1 0
12 13 2 0
24 25 2 0
13 8 1 0
25 26 1 0
3 8 1 0
26 27 2 0
6 7 1 0
27 28 1 0
6 14 1 0
28 29 2 0
29 24 1 0
29 30 1 0
6 15 1 0
30 31 1 0
2 3 1 0
30 32 1 0
14 16 2 0
25 33 1 0
8 9 2 0
33 34 1 0
16 17 1 0
22 35 2 0
2 7 1 0
33 36 1 0
17 18 2 0
19 37 1 0
9 10 1 0
37 38 1 0
18 19 1 0
27 39 1 0
3 4 1 0
19 20 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 515.70Molecular Weight (Monoisotopic): 515.3260AlogP: 6.28#Rotatable Bonds: 8Polar Surface Area: 92.51Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 5.60CX LogP: 5.28CX LogD: 5.27Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.31Np Likeness Score: -1.09
References 1. Asano S, Ban H, Kino K, Ioriya K, Muraoka M.. (2009) Synthesis and structure-activity relationships of N-(4-amino-2,6-diisopropylphenyl)-N'-(1,4-diarylpiperidine-4-yl)methylureas as anti-hyperlipidemic agents., 17 (13): [PMID:19464189 ] [10.1016/j.bmc.2009.04.059 ]