The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N''-[2-(1,3-benzothiazol-2-ylthio)-5,6-dimethoxy-2,3-dihydro-1H-inden-1-ylidene]carbonohydrazonic diamide dihydrochloride ID: ALA3215789
PubChem CID: 44225015
Max Phase: Preclinical
Molecular Formula: C19H21Cl2N5O2S2
Molecular Weight: 413.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2c(cc1OC)/C(=N\N=C(N)N)C(Sc1nc3ccccc3s1)C2.Cl.Cl
Standard InChI: InChI=1S/C19H19N5O2S2.2ClH/c1-25-13-7-10-8-16(28-19-22-12-5-3-4-6-15(12)27-19)17(23-24-18(20)21)11(10)9-14(13)26-2;;/h3-7,9,16H,8H2,1-2H3,(H4,20,21,24);2*1H/b23-17+;;
Standard InChI Key: ANFJLRAXBRIGNB-DQKALADDSA-N
Molfile:
RDKit 2D
30 31 0 0 0 0 0 0 0 0999 V2000
10.3731 0.2552 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
6.5164 5.9854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8290 5.2698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8731 3.7507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2157 5.1993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2685 3.6962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5811 2.9807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3007 1.5139 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.8208 1.3475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1876 2.6658 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0872 0.0382 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1855 -2.6254 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1889 -3.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6614 -5.1720 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8646 -6.0692 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8368 -5.4139 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6187 -1.4919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6251 -2.6919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6187 1.4919 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6251 2.6919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8731 0.2552 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15 14 1 0
14 12 1 0
4 7 2 0
2 3 2 0
15 16 2 0
6 5 2 0
16 17 1 0
7 8 1 0
17 18 2 0
8 9 1 0
18 19 1 0
9 10 2 0
19 20 2 0
20 15 1 0
10 6 1 0
14 21 2 0
5 2 1 0
21 22 1 0
9 11 1 0
22 23 2 0
6 7 1 0
23 24 1 0
11 12 1 0
23 25 1 0
12 13 1 0
19 26 1 0
26 27 1 0
3 4 1 0
18 28 1 0
13 16 1 0
28 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 413.53Molecular Weight (Monoisotopic): 413.0980AlogP: 3.01#Rotatable Bonds: 5Polar Surface Area: 108.11Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.71CX LogP: 3.10CX LogD: 3.02Aromatic Rings: 3Heavy Atoms: 28QED Weighted: 0.38Np Likeness Score: -0.67
References 1. Zhang R, Dong J, Xu YG, Hua WY, Wen N, You QD.. (2009) Synthesis and bioactivity of substituted indan-1-ylideneaminoguanidine derivatives., 44 (9): [PMID:19482383 ] [10.1016/j.ejmech.2009.04.036 ]