The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-Amino-2,6-diisopropylphenyl)-N'-{[4-(3-hydroxyphenyl)-1-(2-methoxyphenyl)piperidin-4-yl]methyl}-urea dihydrochloride ID: ALA3215790
PubChem CID: 90664417
Max Phase: Preclinical
Molecular Formula: C32H44Cl2N4O3
Molecular Weight: 530.71
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1N1CCC(CNC(=O)Nc2c(C(C)C)cc(N)cc2C(C)C)(c2cccc(O)c2)CC1.Cl.Cl
Standard InChI: InChI=1S/C32H42N4O3.2ClH/c1-21(2)26-18-24(33)19-27(22(3)4)30(26)35-31(38)34-20-32(23-9-8-10-25(37)17-23)13-15-36(16-14-32)28-11-6-7-12-29(28)39-5;;/h6-12,17-19,21-22,37H,13-16,20,33H2,1-5H3,(H2,34,35,38);2*1H
Standard InChI Key: SGIFDWNJRRWFMT-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 42 0 0 0 0 0 0 0 0999 V2000
11.5836 -4.5059 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.1597 -1.5281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1622 -0.0281 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8644 0.7241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5641 -0.0238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5978 -1.5030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8594 -2.2759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4631 0.7201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7622 -0.0299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0613 0.7200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0614 2.2200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7624 2.9701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4634 2.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5955 -3.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8937 -3.7570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8914 -5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1896 -6.0110 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1873 -7.5118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4837 -8.2665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4784 -9.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1767 -10.5119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8803 -9.7573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8856 -8.2573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5869 -7.5050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5465 -8.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5890 -6.3050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7876 -7.5234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8239 -8.1286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8511 -5.8559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7940 -6.3234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1724 -11.7119 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7653 -1.5307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8053 -2.1293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0836 -4.5059 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
19 20 2 0
20 14 1 0
10 11 2 0
15 21 1 0
4 5 1 0
21 22 1 0
11 12 1 0
22 23 1 0
5 6 1 0
23 24 1 0
12 13 2 0
24 25 2 0
13 8 1 0
25 26 1 0
3 8 1 0
26 27 2 0
6 7 1 0
27 28 1 0
6 14 1 0
28 29 2 0
29 24 1 0
29 30 1 0
6 15 1 0
30 31 1 0
2 3 1 0
30 32 1 0
14 16 2 0
25 33 1 0
8 9 2 0
33 34 1 0
16 17 1 0
22 35 2 0
2 7 1 0
33 36 1 0
17 18 2 0
27 37 1 0
9 10 1 0
19 38 1 0
18 19 1 0
9 39 1 0
3 4 1 0
39 40 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 530.71Molecular Weight (Monoisotopic): 530.3257AlogP: 6.59#Rotatable Bonds: 8Polar Surface Area: 99.85Molecular Species: NEUTRALHBA: 5HBD: 4#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.44CX Basic pKa: 4.55CX LogP: 6.19CX LogD: 6.19Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.25Np Likeness Score: -0.71
References 1. Asano S, Ban H, Kino K, Ioriya K, Muraoka M.. (2009) Synthesis and structure-activity relationships of N-(4-amino-2,6-diisopropylphenyl)-N'-(1,4-diarylpiperidine-4-yl)methylureas as anti-hyperlipidemic agents., 17 (13): [PMID:19464189 ] [10.1016/j.bmc.2009.04.059 ]