N-(4-Amino-2,6-diisopropylphenyl)-N'-{[1-[3-(3-hydroxypropoxy)pyridin-2-yl]-4-(3-methoxyphenyl)piperidin-4-yl]methyl}urea dihydrochloride

ID: ALA3216237

PubChem CID: 90664676

Max Phase: Preclinical

Molecular Formula: C34H49Cl2N5O4

Molecular Weight: 589.78

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc(C2(CNC(=O)Nc3c(C(C)C)cc(N)cc3C(C)C)CCN(c3ncccc3OCCCO)CC2)c1.Cl.Cl

Standard InChI:  InChI=1S/C34H47N5O4.2ClH/c1-23(2)28-20-26(35)21-29(24(3)4)31(28)38-33(41)37-22-34(25-9-6-10-27(19-25)42-5)12-15-39(16-13-34)32-30(11-7-14-36-32)43-18-8-17-40;;/h6-7,9-11,14,19-21,23-24,40H,8,12-13,15-18,22,35H2,1-5H3,(H2,37,38,41);2*1H

Standard InChI Key:  FQVSTMRMZCCFGP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 45 46  0  0  0  0  0  0  0  0999 V2000
    9.0198    1.5191    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5987    1.5004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8990    0.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1969    1.5046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1945    3.0046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8943    3.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5964    3.0005    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2627   -2.2304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5625    0.0216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5430   -3.0120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5063   -4.5115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1892   -5.2295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0910   -4.4478    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0543   -2.9483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5632    1.5224    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8628    2.2731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8634    3.7739    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1630    4.5246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1658    6.0246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4662    6.7722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7639    6.0198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7612    4.5198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4608    3.7722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4611    2.2714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5002    1.6710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4219    1.6714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8690    6.7801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8730    7.9801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9019    1.6729    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8276    6.1839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.8042    6.6179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9046   -0.7483    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2066   -1.4947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2122   -2.9956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5142   -3.7420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5186   -4.9420    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4103   -5.1635    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4336   -4.5367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5198    1.5191    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  4  5  1  0
 21 22  1  0
 11 12  1  0
 22 23  1  0
  5  6  1  0
 23 24  1  0
 12 13  2  0
 24 25  2  0
 13  8  1  0
 25 26  1  0
  3  8  1  0
 26 27  2  0
  6  7  1  0
 27 28  1  0
  6 14  1  0
 28 29  2  0
 29 24  1  0
 29 30  1  0
  6 15  1  0
 30 31  1  0
  2  3  1  0
 30 32  1  0
 14 16  2  0
 25 33  1  0
  8  9  2  0
 33 34  1  0
 16 17  1  0
 22 35  2  0
  2  7  1  0
 33 36  1  0
 17 18  2  0
 27 37  1  0
  9 10  1  0
  9 38  1  0
 18 19  1  0
 38 39  1  0
  3  4  1  0
 39 40  1  0
 19 20  2  0
 40 41  1  0
 20 14  1  0
 41 42  1  0
 10 11  2  0
 19 43  1  0
 15 21  1  0
 43 44  1  0
M  END

Associated Targets(non-human)

Soat1 Acyl coenzyme A:cholesterol acyltransferase 1 (2344 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 589.78Molecular Weight (Monoisotopic): 589.3628AlogP: 6.04#Rotatable Bonds: 12
Polar Surface Area: 121.97Molecular Species: NEUTRALHBA: 7HBD: 4
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 6.18CX LogP: 5.08CX LogD: 5.06
Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.15Np Likeness Score: -0.75

References

1. Asano S, Ban H, Kino K, Ioriya K, Muraoka M..  (2009)  Synthesis and structure-activity relationships of N-(4-amino-2,6-diisopropylphenyl)-N'-(1,4-diarylpiperidine-4-yl)methylureas as anti-hyperlipidemic agents.,  17  (13): [PMID:19464189] [10.1016/j.bmc.2009.04.059]

Source