The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-Amino-2,6-diisopropylphenyl)-N'-{[1-[3-(3-hydroxypropoxy)pyridin-2-yl]-4-(3-methoxyphenyl)piperidin-4-yl]methyl}urea dihydrochloride ID: ALA3216237
PubChem CID: 90664676
Max Phase: Preclinical
Molecular Formula: C34H49Cl2N5O4
Molecular Weight: 589.78
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(C2(CNC(=O)Nc3c(C(C)C)cc(N)cc3C(C)C)CCN(c3ncccc3OCCCO)CC2)c1.Cl.Cl
Standard InChI: InChI=1S/C34H47N5O4.2ClH/c1-23(2)28-20-26(35)21-29(24(3)4)31(28)38-33(41)37-22-34(25-9-6-10-27(19-25)42-5)12-15-39(16-13-34)32-30(11-7-14-36-32)43-18-8-17-40;;/h6-7,9-11,14,19-21,23-24,40H,8,12-13,15-18,22,35H2,1-5H3,(H2,37,38,41);2*1H
Standard InChI Key: FQVSTMRMZCCFGP-UHFFFAOYSA-N
Molfile:
RDKit 2D
45 46 0 0 0 0 0 0 0 0999 V2000
9.0198 1.5191 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 1.5046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 3.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5964 3.0005 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2627 -2.2304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5625 0.0216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5430 -3.0120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5063 -4.5115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1892 -5.2295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0910 -4.4478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0543 -2.9483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5632 1.5224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8628 2.2731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8634 3.7739 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1630 4.5246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1658 6.0246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4662 6.7722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7639 6.0198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7612 4.5198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4608 3.7722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4611 2.2714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5002 1.6710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4219 1.6714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8690 6.7801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8730 7.9801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9019 1.6729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8276 6.1839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8042 6.6179 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9046 -0.7483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2066 -1.4947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2122 -2.9956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5142 -3.7420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5186 -4.9420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4103 -5.1635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4336 -4.5367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5198 1.5191 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4 5 1 0
21 22 1 0
11 12 1 0
22 23 1 0
5 6 1 0
23 24 1 0
12 13 2 0
24 25 2 0
13 8 1 0
25 26 1 0
3 8 1 0
26 27 2 0
6 7 1 0
27 28 1 0
6 14 1 0
28 29 2 0
29 24 1 0
29 30 1 0
6 15 1 0
30 31 1 0
2 3 1 0
30 32 1 0
14 16 2 0
25 33 1 0
8 9 2 0
33 34 1 0
16 17 1 0
22 35 2 0
2 7 1 0
33 36 1 0
17 18 2 0
27 37 1 0
9 10 1 0
9 38 1 0
18 19 1 0
38 39 1 0
3 4 1 0
39 40 1 0
19 20 2 0
40 41 1 0
20 14 1 0
41 42 1 0
10 11 2 0
19 43 1 0
15 21 1 0
43 44 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 589.78Molecular Weight (Monoisotopic): 589.3628AlogP: 6.04#Rotatable Bonds: 12Polar Surface Area: 121.97Molecular Species: NEUTRALHBA: 7HBD: 4#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 6.18CX LogP: 5.08CX LogD: 5.06Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.15Np Likeness Score: -0.75
References 1. Asano S, Ban H, Kino K, Ioriya K, Muraoka M.. (2009) Synthesis and structure-activity relationships of N-(4-amino-2,6-diisopropylphenyl)-N'-(1,4-diarylpiperidine-4-yl)methylureas as anti-hyperlipidemic agents., 17 (13): [PMID:19464189 ] [10.1016/j.bmc.2009.04.059 ]