The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-Amino-2,6-diisopropylphenyl)-N'-{[1-(2-isopropoxyphenyl)-4-(3-methoxyphenyl)piperidin-4-yl]methyl}-urea dihydrochloride ID: ALA3216677
PubChem CID: 90664921
Max Phase: Preclinical
Molecular Formula: C35H50Cl2N4O3
Molecular Weight: 572.79
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(C2(CNC(=O)Nc3c(C(C)C)cc(N)cc3C(C)C)CCN(c3ccccc3OC(C)C)CC2)c1.Cl.Cl
Standard InChI: InChI=1S/C35H48N4O3.2ClH/c1-23(2)29-20-27(36)21-30(24(3)4)33(29)38-34(40)37-22-35(26-11-10-12-28(19-26)41-7)15-17-39(18-16-35)31-13-8-9-14-32(31)42-25(5)6;;/h8-14,19-21,23-25H,15-18,22,36H2,1-7H3,(H2,37,38,40);2*1H
Standard InChI Key: IBYHHRAYZCZWCY-UHFFFAOYSA-N
Molfile:
RDKit 2D
44 45 0 0 0 0 0 0 0 0999 V2000
9.0038 1.5257 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 1.5046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 3.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5964 3.0005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2627 -2.2304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5625 0.0216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5430 -3.0120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5063 -4.5115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1892 -5.2295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0910 -4.4478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0543 -2.9483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5632 1.5224 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.8628 2.2731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8634 3.7739 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1630 4.5246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1658 6.0246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4662 6.7722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7639 6.0198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7612 4.5198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4608 3.7722 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4611 2.2714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5002 1.6710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4219 1.6714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8690 6.7801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8730 7.9801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9019 1.6729 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8276 6.1839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4103 -5.1635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4336 -4.5367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8042 6.6179 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9046 -0.7483 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2066 -1.4947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2111 -2.6947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2438 -0.8912 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5038 1.5257 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15 21 1 0
4 5 1 0
21 22 1 0
11 12 1 0
22 23 1 0
5 6 1 0
23 24 1 0
12 13 2 0
24 25 2 0
13 8 1 0
25 26 1 0
3 8 1 0
26 27 2 0
6 7 1 0
27 28 1 0
6 14 1 0
28 29 2 0
29 24 1 0
29 30 1 0
6 15 1 0
30 31 1 0
2 3 1 0
30 32 1 0
14 16 2 0
25 33 1 0
8 9 2 0
33 34 1 0
16 17 1 0
22 35 2 0
2 7 1 0
33 36 1 0
17 18 2 0
19 37 1 0
9 10 1 0
37 38 1 0
18 19 1 0
27 39 1 0
3 4 1 0
9 40 1 0
19 20 2 0
40 41 1 0
20 14 1 0
41 42 1 0
10 11 2 0
41 43 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 572.79Molecular Weight (Monoisotopic): 572.3726AlogP: 7.67#Rotatable Bonds: 10Polar Surface Area: 88.85Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 4.53CX LogP: 7.11CX LogD: 7.11Aromatic Rings: 3Heavy Atoms: 42QED Weighted: 0.22Np Likeness Score: -0.93
References 1. Asano S, Ban H, Kino K, Ioriya K, Muraoka M.. (2009) Synthesis and structure-activity relationships of N-(4-amino-2,6-diisopropylphenyl)-N'-(1,4-diarylpiperidine-4-yl)methylureas as anti-hyperlipidemic agents., 17 (13): [PMID:19464189 ] [10.1016/j.bmc.2009.04.059 ]