The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-hydroxy-3-(2-phenethyl-1-(2-(piperidin-1-yl)ethyl)-1H-benzo[d]imidazol-5-yl)acrylamide dihydrochloride ID: ALA3216905
PubChem CID: 90665048
Max Phase: Preclinical
Molecular Formula: C25H32Cl2N4O2
Molecular Weight: 418.54
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cl.Cl.O=C(/C=C/c1ccc2c(c1)nc(CCc1ccccc1)n2CCN1CCCCC1)NO
Standard InChI: InChI=1S/C25H30N4O2.2ClH/c30-25(27-31)14-11-21-9-12-23-22(19-21)26-24(13-10-20-7-3-1-4-8-20)29(23)18-17-28-15-5-2-6-16-28;;/h1,3-4,7-9,11-12,14,19,31H,2,5-6,10,13,15-18H2,(H,27,30);2*1H/b14-11+;;
Standard InChI Key: RLDKZHWPSMUDLF-IVKCLRODSA-N
Molfile:
RDKit 2D
33 34 0 0 0 0 0 0 0 0999 V2000
11.8512 2.1243 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6217 -1.4865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9153 -0.7255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2216 -1.4644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5151 -0.7033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.2318 -2.6643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.5596 -1.2941 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0872 0.0320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8506 -1.2602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3513 -1.2462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1161 -2.5367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6160 -2.5196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3512 -1.2122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5865 0.0783 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0866 0.0613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1812 2.6271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6500 2.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1182 4.3614 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5858 4.6718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0509 6.0979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0484 7.2137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5808 6.9034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1158 5.4773 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3512 2.1243 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
14 16 1 0
4 5 2 0
9 17 1 0
7 8 1 0
17 18 1 0
8 9 2 0
18 19 1 0
9 10 1 0
19 20 2 0
10 6 1 0
20 21 1 0
5 7 1 0
21 22 2 0
4 11 1 0
22 23 1 0
6 7 2 0
23 24 2 0
24 19 1 0
11 12 2 0
10 25 1 0
2 3 2 0
25 26 1 0
12 13 1 0
26 27 1 0
27 28 1 0
6 2 1 0
13 14 1 0
3 4 1 0
13 15 2 0
27 32 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 418.54Molecular Weight (Monoisotopic): 418.2369AlogP: 3.83#Rotatable Bonds: 8Polar Surface Area: 70.39Molecular Species: BASEHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.70CX Basic pKa: 9.01CX LogP: 3.62CX LogD: 2.35Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.33Np Likeness Score: -1.03
References 1. Wang H, Yu N, Song H, Chen D, Zou Y, Deng W, Lye PL, Chang J, Ng M, Sun ET, Sangthongpitag K, Wang X, Wu X, Khng HH, Fang L, Goh SK, Ong WC, Bonday Z, Stünkel W, Poulsen A, Entzeroth M.. (2009) N-Hydroxy-1,2-disubstituted-1H-benzimidazol-5-yl acrylamides as novel histone deacetylase inhibitors: design, synthesis, SAR studies, and in vivo antitumor activity., 19 (5): [PMID:19181524 ] [10.1016/j.bmcl.2009.01.041 ]