The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(4-Amino-2,6-diisopropylphenyl)-N'-{[4-(3-methoxyphenyl)-1-(3-methoxypyridin-2-yl)piperidin-4-yl]-methyl}urea dihydrochloride ID: ALA3217123
PubChem CID: 90665164
Max Phase: Preclinical
Molecular Formula: C32H45Cl2N5O3
Molecular Weight: 545.73
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1cccc(C2(CNC(=O)Nc3c(C(C)C)cc(N)cc3C(C)C)CCN(c3ncccc3OC)CC2)c1.Cl.Cl
Standard InChI: InChI=1S/C32H43N5O3.2ClH/c1-21(2)26-18-24(33)19-27(22(3)4)29(26)36-31(38)35-20-32(23-9-7-10-25(17-23)39-5)12-15-37(16-13-32)30-28(40-6)11-8-14-34-30;;/h7-11,14,17-19,21-22H,12-13,15-16,20,33H2,1-6H3,(H2,35,36,38);2*1H
Standard InChI Key: BWXVJFUYSGNCAR-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 43 0 0 0 0 0 0 0 0999 V2000
11.5836 -4.1316 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.1597 -1.5281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1622 -0.0281 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8644 0.7241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5641 -0.0238 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5978 -1.5030 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8594 -2.2759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4631 0.7201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7622 -0.0299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0613 0.7200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0614 2.2200 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7624 2.9701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4634 2.2202 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5955 -3.0038 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8937 -3.7570 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8914 -5.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1896 -6.0110 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1873 -7.5118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4837 -8.2665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4784 -9.7665 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1767 -10.5119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8803 -9.7573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8856 -8.2573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5869 -7.5050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5465 -8.1029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5890 -6.3050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7876 -7.5234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8239 -8.1286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8511 -5.8559 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7940 -6.3234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0432 3.5994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1724 -11.7119 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.7653 -1.5307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8053 -2.1293 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0836 -4.1316 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
20 14 1 0
10 11 2 0
15 21 1 0
4 5 1 0
21 22 1 0
11 12 1 0
22 23 1 0
5 6 1 0
23 24 1 0
12 13 2 0
24 25 2 0
13 8 1 0
25 26 1 0
3 8 1 0
26 27 2 0
6 7 1 0
27 28 1 0
6 14 1 0
28 29 2 0
29 24 1 0
29 30 1 0
6 15 1 0
30 31 1 0
2 3 1 0
30 32 1 0
14 16 2 0
25 33 1 0
8 9 2 0
33 34 1 0
16 17 1 0
22 35 2 0
2 7 1 0
33 36 1 0
17 18 2 0
19 37 1 0
9 10 1 0
37 38 1 0
18 19 1 0
27 39 1 0
3 4 1 0
9 40 1 0
19 20 2 0
40 41 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 545.73Molecular Weight (Monoisotopic): 545.3366AlogP: 6.29#Rotatable Bonds: 9Polar Surface Area: 101.74Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 6.19CX LogP: 5.71CX LogD: 5.69Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.27Np Likeness Score: -0.89
References 1. Asano S, Ban H, Kino K, Ioriya K, Muraoka M.. (2009) Synthesis and structure-activity relationships of N-(4-amino-2,6-diisopropylphenyl)-N'-(1,4-diarylpiperidine-4-yl)methylureas as anti-hyperlipidemic agents., 17 (13): [PMID:19464189 ] [10.1016/j.bmc.2009.04.059 ]