N-(4-Amino-2,6-diisopropylphenyl)-N'-{[4-(3-methoxyphenyl)-1-(3-methoxypyridin-2-yl)piperidin-4-yl]-methyl}urea dihydrochloride

ID: ALA3217123

PubChem CID: 90665164

Max Phase: Preclinical

Molecular Formula: C32H45Cl2N5O3

Molecular Weight: 545.73

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1cccc(C2(CNC(=O)Nc3c(C(C)C)cc(N)cc3C(C)C)CCN(c3ncccc3OC)CC2)c1.Cl.Cl

Standard InChI:  InChI=1S/C32H43N5O3.2ClH/c1-21(2)26-18-24(33)19-27(22(3)4)29(26)36-31(38)35-20-32(23-9-7-10-25(17-23)39-5)12-15-37(16-13-32)30-28(40-6)11-8-14-34-30;;/h7-11,14,17-19,21-22H,12-13,15-16,20,33H2,1-6H3,(H2,35,36,38);2*1H

Standard InChI Key:  BWXVJFUYSGNCAR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 42 43  0  0  0  0  0  0  0  0999 V2000
   11.5836   -4.1316    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.1597   -1.5281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1622   -0.0281    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8644    0.7241    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5641   -0.0238    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5978   -1.5030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8594   -2.2759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4631    0.7201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7622   -0.0299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0613    0.7200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0614    2.2200    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7624    2.9701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4634    2.2202    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5955   -3.0038    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8937   -3.7570    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8914   -5.2578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1896   -6.0110    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1873   -7.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4837   -8.2665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4784   -9.7665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1767  -10.5119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8803   -9.7573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8856   -8.2573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5869   -7.5050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5465   -8.1029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5890   -6.3050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7876   -7.5234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8239   -8.1286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8511   -5.8559    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7940   -6.3234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0031    3.0008    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0432    3.5994    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1724  -11.7119    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.7653   -1.5307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8053   -2.1293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0836   -4.1316    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
 20 14  1  0
 10 11  2  0
 15 21  1  0
  4  5  1  0
 21 22  1  0
 11 12  1  0
 22 23  1  0
  5  6  1  0
 23 24  1  0
 12 13  2  0
 24 25  2  0
 13  8  1  0
 25 26  1  0
  3  8  1  0
 26 27  2  0
  6  7  1  0
 27 28  1  0
  6 14  1  0
 28 29  2  0
 29 24  1  0
 29 30  1  0
  6 15  1  0
 30 31  1  0
  2  3  1  0
 30 32  1  0
 14 16  2  0
 25 33  1  0
  8  9  2  0
 33 34  1  0
 16 17  1  0
 22 35  2  0
  2  7  1  0
 33 36  1  0
 17 18  2  0
 19 37  1  0
  9 10  1  0
 37 38  1  0
 18 19  1  0
 27 39  1  0
  3  4  1  0
  9 40  1  0
 19 20  2  0
 40 41  1  0
M  END

Associated Targets(non-human)

Soat1 Acyl coenzyme A:cholesterol acyltransferase 1 (2344 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 545.73Molecular Weight (Monoisotopic): 545.3366AlogP: 6.29#Rotatable Bonds: 9
Polar Surface Area: 101.74Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: 6.19CX LogP: 5.71CX LogD: 5.69
Aromatic Rings: 3Heavy Atoms: 40QED Weighted: 0.27Np Likeness Score: -0.89

References

1. Asano S, Ban H, Kino K, Ioriya K, Muraoka M..  (2009)  Synthesis and structure-activity relationships of N-(4-amino-2,6-diisopropylphenyl)-N'-(1,4-diarylpiperidine-4-yl)methylureas as anti-hyperlipidemic agents.,  17  (13): [PMID:19464189] [10.1016/j.bmc.2009.04.059]

Source