The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1-(2-Acetylamino-3-hydroxy-propionyl)-pyrrolidine-2-carboxylic acid {1-[1-(1-carbamoyl-2-hydroxy-ethylcarbamoyl)-4-guanidino-butylcarbamoyl]-2-phenyl-ethyl}-amide ID: ALA321718
PubChem CID: 14999610
Max Phase: Preclinical
Molecular Formula: C28H43N9O8
Molecular Weight: 633.71
Molecule Type: Protein
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)N[C@@H](CO)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CO)C(N)=O
Standard InChI: InChI=1S/C28H43N9O8/c1-16(40)33-21(15-39)27(45)37-12-6-10-22(37)26(44)35-19(13-17-7-3-2-4-8-17)25(43)34-18(9-5-11-32-28(30)31)24(42)36-20(14-38)23(29)41/h2-4,7-8,18-22,38-39H,5-6,9-15H2,1H3,(H2,29,41)(H,33,40)(H,34,43)(H,35,44)(H,36,42)(H4,30,31,32)/t18-,19-,20-,21-,22-/m0/s1
Standard InChI Key: MZNNHWHLAUCULO-YFNVTMOMSA-N
Molfile:
RDKit 2D
45 46 0 0 1 0 0 0 0 0999 V2000
-1.6000 -3.5750 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0208 -2.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1500 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5875 -2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8583 -3.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9625 -3.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0792 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7792 -3.9042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.5542 -3.9042 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4875 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6667 -3.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2542 -3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1917 -3.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0500 -1.4292 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7792 -7.1625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3667 -3.9042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8708 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4875 -7.5667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.7708 -2.8500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1708 -2.6417 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9625 -4.7167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0792 -2.6792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2542 -2.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1917 -4.7167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3458 -0.8167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.7792 -6.3417 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0792 -7.5667 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8917 -3.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1458 -4.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7750 -2.0417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6667 -1.9625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4875 -2.6792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9458 -4.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3583 -1.3250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1917 -2.2792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7375 -4.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2250 -2.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3667 -4.7167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0792 -5.9417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4917 -1.9542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2417 -1.2542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0792 -5.1292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6500 -0.5375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9000 -1.2417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4792 -0.5292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
5 3 1 6
4 2 1 0
5 1 1 0
6 12 1 0
7 16 1 0
8 7 1 0
9 3 1 0
10 8 1 1
11 6 1 0
12 9 1 1
13 10 1 0
4 14 1 1
15 26 2 0
16 11 1 6
17 14 1 0
18 15 1 0
19 2 2 0
20 3 2 0
21 6 2 0
22 7 2 0
12 23 1 0
24 13 2 0
25 17 2 0
26 39 1 0
27 15 1 0
28 13 1 0
29 1 1 0
4 30 1 0
31 23 1 0
10 32 1 0
5 33 1 0
34 30 1 0
35 32 1 0
36 29 1 0
37 17 1 0
16 38 1 0
39 42 1 0
40 31 2 0
41 31 1 0
42 38 1 0
43 41 2 0
44 40 1 0
45 43 1 0
36 33 1 0
44 45 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 633.71Molecular Weight (Monoisotopic): 633.3235AlogP: -4.30#Rotatable Bonds: 17Polar Surface Area: 284.66Molecular Species: BASEHBA: 9HBD: 9#RO5 Violations: 2HBA (Lipinski): 17HBD (Lipinski): 12#RO5 Violations (Lipinski): 3CX Acidic pKa: 11.67CX Basic pKa: 10.77CX LogP: -5.12CX LogD: -7.21Aromatic Rings: 1Heavy Atoms: 45QED Weighted: 0.05Np Likeness Score: 0.11
References 1. Deshpande MS, Burton J.. (1992) Mapping the binding site of tissue kallikrein: preparation and testing of all possible substrate analog inhibitors homologous with the sequence of kininogen between Ser386 and Gln392., 35 (17): [PMID:1507198 ] [10.1021/jm00095a002 ]