The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-benzyl 2-((S)-2-((S)-2,4-diamino-4-oxobutanamido)-3-(1H-indol-3-yl)propanamido)-3-(1H-indol-3-yl)propanoate ID: ALA3217839
PubChem CID: 90665289
Max Phase: Preclinical
Molecular Formula: C33H34N6O5
Molecular Weight: 594.67
Molecule Type: Protein
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)C[C@H](N)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)OCc1ccccc1
Standard InChI: InChI=1S/C33H34N6O5/c34-25(16-30(35)40)31(41)38-28(14-21-17-36-26-12-6-4-10-23(21)26)32(42)39-29(33(43)44-19-20-8-2-1-3-9-20)15-22-18-37-27-13-7-5-11-24(22)27/h1-13,17-18,25,28-29,36-37H,14-16,19,34H2,(H2,35,40)(H,38,41)(H,39,42)/t25-,28-,29-/m0/s1
Standard InChI Key: UNIUMGHNUXLZDA-FMYROPPKSA-N
Molfile:
RDKit 2D
44 48 0 0 0 0 0 0 0 0999 V2000
4.7949 -17.1347 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5075 -16.7305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2075 -17.9648 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2138 -17.1456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5059 -15.9096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7974 -15.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7994 -14.6742 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9304 -16.7385 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.6398 -17.1557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3593 -15.9265 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.3539 -16.7477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6344 -17.9769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0961 -18.0627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3429 -18.3901 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6390 -18.6782 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.4229 -19.2075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2218 -19.3876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4732 -20.1699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9176 -20.7738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1156 -20.5986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8682 -19.8154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0633 -17.1650 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.7782 -16.7610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4772 -17.9962 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.4827 -17.1750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7836 -15.9398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.2465 -15.8731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4977 -15.5318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8012 -15.2652 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.5885 -14.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3932 -14.5511 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6557 -13.7751 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1088 -13.1604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3041 -13.3250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0464 -14.1042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1976 -16.7711 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.9015 -17.1862 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6129 -16.7842 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3141 -17.2004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0251 -16.7990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.0331 -15.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.3242 -15.5660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.6162 -15.9697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0886 -15.9043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 4 1 0
4 3 2 0
2 5 1 1
5 6 1 0
6 7 1 0
4 8 1 0
11 22 1 0
25 36 1 0
8 9 1 0
9 11 1 0
11 10 2 0
9 12 1 6
12 14 1 0
13 14 2 0
14 16 1 0
15 13 1 0
17 15 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 16 1 0
22 23 1 0
23 25 1 0
25 24 2 0
23 26 1 1
26 28 1 0
27 28 2 0
28 30 1 0
29 27 1 0
31 29 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
36 37 1 0
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 38 1 0
6 44 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: ProteinTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 594.67Molecular Weight (Monoisotopic): 594.2591AlogP: 2.35#Rotatable Bonds: 13Polar Surface Area: 185.19Molecular Species: NEUTRALHBA: 6HBD: 6#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 8#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.09CX Basic pKa: 7.05CX LogP: 2.28CX LogD: 2.12Aromatic Rings: 5Heavy Atoms: 44QED Weighted: 0.11Np Likeness Score: -0.03
References 1. Liu L, Wei L, Yang Y, Zhao M, Zhang X, Zheng M, Wang Y, Peng S. (2011) A class of novel AA-Trp-Trp-OBzl: synthesis, in vitro anti-proliferation, in vivo anti-tumor action, and intercalation mechanism, 2 (2): [10.1039/C0MD00208A ]