The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-2-((S)-2-((S)-2-((R)-2-amino-3-mercaptopropylamino)-3-methylbutoxy)-3-phenylpropanamido)-4-(methylsulfonyl)butanoic acid ID: ALA3218393
PubChem CID: 90665660
Max Phase: Preclinical
Molecular Formula: C22H37N3O6S2
Molecular Weight: 503.69
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)[C@@H](CO[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCS(C)(=O)=O)C(=O)O)NC[C@@H](N)CS
Standard InChI: InChI=1S/C22H37N3O6S2/c1-15(2)19(24-12-17(23)14-32)13-31-20(11-16-7-5-4-6-8-16)21(26)25-18(22(27)28)9-10-33(3,29)30/h4-8,15,17-20,24,32H,9-14,23H2,1-3H3,(H,25,26)(H,27,28)/t17-,18+,19-,20+/m1/s1
Standard InChI Key: DBWZOKRHHKZPJP-WCIQWLHISA-N
Molfile:
RDKit 2D
33 33 0 0 0 0 0 0 0 0999 V2000
1.9425 -8.3539 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6569 -7.9412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3713 -8.3539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6569 -7.1162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3713 -6.7035 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
4.0879 -7.9412 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.7983 -8.3539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5126 -7.9412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7983 -9.1789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5126 -9.5916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0879 -9.5916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2271 -8.3539 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.9416 -7.9412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6582 -9.1789 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6582 -8.3539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9416 -7.1162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6582 -5.8800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6582 -6.7035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3713 -7.1154 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0802 -6.7035 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0802 -5.8800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3713 -5.4683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3685 -7.9412 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.0829 -8.3539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7974 -7.1162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7974 -7.9412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0829 -9.1789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5140 -8.3539 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.7953 -9.5895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.7953 -10.4104 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.5076 -10.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9925 -10.1916 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3755 -11.1199 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3 6 1 0
8 12 1 0
15 23 1 0
26 28 1 0
1 2 1 0
2 3 1 0
2 4 1 1
4 5 1 0
6 7 1 0
7 8 1 0
7 9 1 6
9 10 1 0
9 11 1 0
12 13 1 0
13 15 1 0
15 14 2 0
13 16 1 1
16 18 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
24 23 1 0
24 26 1 0
26 25 2 0
24 27 1 6
27 29 1 0
29 30 1 0
30 31 1 0
30 32 2 0
30 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 503.69Molecular Weight (Monoisotopic): 503.2124AlogP: 0.49#Rotatable Bonds: 16Polar Surface Area: 147.82Molecular Species: ZWITTERIONHBA: 8HBD: 5#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 3.10CX Basic pKa: 9.42CX LogP: -2.15CX LogD: -2.25Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.20Np Likeness Score: -0.05
References 1. Ochocki JD, Distefano MD.. (2013) Prenyltransferase Inhibitors: Treating Human Ailments from Cancer to Parasitic Infections., 4 (3): [PMID:25530833 ] [10.1039/c2md20299a ]