The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S,6S,7R)-7-hydroxy-2-(4-(4-methoxybenzyloxy)but-2-en-2-yl)-7-methyl-12-oxooxacyclododec-4-en-6-yl acetate ID: ALA3220173
PubChem CID: 90666873
Max Phase: Preclinical
Molecular Formula: C26H36O7
Molecular Weight: 460.57
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(COC/C=C(\C)[C@@H]2C/C=C/[C@H](OC(C)=O)[C@](C)(O)CCCCC(=O)O2)cc1
Standard InChI: InChI=1S/C26H36O7/c1-19(15-17-31-18-21-11-13-22(30-4)14-12-21)23-8-7-9-24(32-20(2)27)26(3,29)16-6-5-10-25(28)33-23/h7,9,11-15,23-24,29H,5-6,8,10,16-18H2,1-4H3/b9-7+,19-15+/t23-,24-,26+/m0/s1
Standard InChI Key: OMGJVHZDGKDSIE-VSZAKUGESA-N
Molfile:
RDKit 2D
33 34 0 0 0 0 0 0 0 0999 V2000
13.2186 -11.6939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3682 -10.4529 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
13.9324 -11.2802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3682 -8.7983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6503 -10.0392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9324 -7.9709 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7997 -10.4529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9074 -9.2026 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0804 -9.2098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.3682 -11.2802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.5008 -11.2802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.2186 -12.5212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0861 -11.6939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9324 -10.4529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7886 -12.5134 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6503 -6.7300 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.6503 -9.2119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.0861 -10.0392 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7997 -11.2802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7871 -11.6939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6503 -7.5573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.6503 -11.6939 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.4918 -8.4886 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.3682 -7.9709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.0798 -12.9244 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0813 -13.7439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3718 -14.1503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3729 -14.9689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0839 -15.3782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7952 -14.9627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7905 -14.1453 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0865 -16.1977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.3781 -16.6096 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
22 10 1 0
11 20 1 0
24 21 1 0
10 2 2 0
19 13 1 0
18 7 1 0
8 9 1 0
9 18 1 0
10 13 1 0
17 4 1 0
4 9 1 0
3 14 1 0
5 17 2 0
3 1 1 6
1 11 2 0
14 5 1 0
21 6 1 0
7 19 1 0
21 16 2 0
1 12 1 0
20 15 1 0
9 23 1 6
3 22 1 0
4 24 1 6
15 25 1 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 26 1 0
29 32 1 0
32 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 460.57Molecular Weight (Monoisotopic): 460.2461AlogP: 4.27#Rotatable Bonds: 7Polar Surface Area: 91.29Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.97CX Basic pKa: ┄CX LogP: 3.67CX LogD: 3.67Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: 1.69
References 1. Gundluru MK, Pourpak A, Cui X, Morris SW, Webb TR.. (2011) Design, synthesis and initial biological evaluation of a novel pladienolide analog scaffold., 2 (9): [PMID:21927710 ] [10.1039/c1md00040c ]