(2S,6S,7R)-7-hydroxy-2-(4-(4-methoxybenzyloxy)but-2-en-2-yl)-7-methyl-12-oxooxacyclododec-4-en-6-yl acetate

ID: ALA3220173

PubChem CID: 90666873

Max Phase: Preclinical

Molecular Formula: C26H36O7

Molecular Weight: 460.57

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc(COC/C=C(\C)[C@@H]2C/C=C/[C@H](OC(C)=O)[C@](C)(O)CCCCC(=O)O2)cc1

Standard InChI:  InChI=1S/C26H36O7/c1-19(15-17-31-18-21-11-13-22(30-4)14-12-21)23-8-7-9-24(32-20(2)27)26(3,29)16-6-5-10-25(28)33-23/h7,9,11-15,23-24,29H,5-6,8,10,16-18H2,1-4H3/b9-7+,19-15+/t23-,24-,26+/m0/s1

Standard InChI Key:  OMGJVHZDGKDSIE-VSZAKUGESA-N

Molfile:  

     RDKit          2D

 33 34  0  0  0  0  0  0  0  0999 V2000
   13.2186  -11.6939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3682  -10.4529    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9324  -11.2802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3682   -8.7983    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6503  -10.0392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9324   -7.9709    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7997  -10.4529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9074   -9.2026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0804   -9.2098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3682  -11.2802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5008  -11.2802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2186  -12.5212    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0861  -11.6939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9324  -10.4529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7886  -12.5134    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6503   -6.7300    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.6503   -9.2119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0861  -10.0392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.7997  -11.2802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7871  -11.6939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6503   -7.5573    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6503  -11.6939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.4918   -8.4886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.3682   -7.9709    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0798  -12.9244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0813  -13.7439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3718  -14.1503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3729  -14.9689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0839  -15.3782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7952  -14.9627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7905  -14.1453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0865  -16.1977    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3781  -16.6096    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 22 10  1  0
 11 20  1  0
 24 21  1  0
 10  2  2  0
 19 13  1  0
 18  7  1  0
  8  9  1  0
  9 18  1  0
 10 13  1  0
 17  4  1  0
  4  9  1  0
  3 14  1  0
  5 17  2  0
  3  1  1  6
  1 11  2  0
 14  5  1  0
 21  6  1  0
  7 19  1  0
 21 16  2  0
  1 12  1  0
 20 15  1  0
  9 23  1  6
  3 22  1  0
  4 24  1  6
 15 25  1  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 26  1  0
 29 32  1  0
 32 33  1  0
M  END

Associated Targets(Human)

SK-MEL-2 (46422 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 460.57Molecular Weight (Monoisotopic): 460.2461AlogP: 4.27#Rotatable Bonds: 7
Polar Surface Area: 91.29Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 13.97CX Basic pKa: CX LogP: 3.67CX LogD: 3.67
Aromatic Rings: 1Heavy Atoms: 33QED Weighted: 0.37Np Likeness Score: 1.69

References

1. Gundluru MK, Pourpak A, Cui X, Morris SW, Webb TR..  (2011)  Design, synthesis and initial biological evaluation of a novel pladienolide analog scaffold.,  (9): [PMID:21927710] [10.1039/c1md00040c]

Source