3-(6-chloro-2,2-dimethyl-4-(4-nitrophenyl)chroman-8-yl)phenol

ID: ALA3220414

PubChem CID: 90667087

Max Phase: Preclinical

Molecular Formula: C23H20ClNO4

Molecular Weight: 409.87

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC1(C)CC(c2ccc([N+](=O)[O-])cc2)c2cc(Cl)cc(-c3cccc(O)c3)c2O1

Standard InChI:  InChI=1S/C23H20ClNO4/c1-23(2)13-21(14-6-8-17(9-7-14)25(27)28)20-12-16(24)11-19(22(20)29-23)15-4-3-5-18(26)10-15/h3-12,21,26H,13H2,1-2H3

Standard InChI Key:  YPIVQVHBBKBBPV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
    7.0167  -21.3624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1922  -21.3624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6044  -22.0765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3257  -20.5420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3246  -21.3689    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0390  -21.7816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0372  -20.1296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7522  -20.5384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7556  -21.3710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4744  -21.7821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1909  -20.5325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4675  -20.1169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4638  -19.2931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1773  -18.8774    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1731  -18.0537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4562  -17.6445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7421  -18.0652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7498  -18.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4451  -16.8212    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7283  -16.4139    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1564  -16.4042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6138  -20.1302    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.0380  -22.6013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3216  -23.0118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3198  -23.8355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0336  -24.2498    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7508  -23.8344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7491  -23.0120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6049  -24.2461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  7  4  1  0
 14 15  1  0
  8  9  1  0
 15 16  2  0
  2  1  1  0
 16 17  1  0
  4  5  2  0
 17 18  2  0
 18 13  1  0
 12 13  1  0
  3  2  1  0
  5  6  1  0
  6  9  2  0
 19 20  2  0
 19 21  1  0
 16 19  1  0
  8 12  1  0
  4 22  1  0
  9 10  1  0
 10  2  1  0
 23 24  2  0
  2 11  1  0
 24 25  1  0
 11 12  1  0
 25 26  2  0
 26 27  1  0
  8  7  2  0
 27 28  2  0
 28 23  1  0
  6 23  1  0
 13 14  2  0
 25 29  1  0
M  CHG  2  19   1  21  -1
M  END

Associated Targets(non-human)

C3H 10T1/2 (488 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 409.87Molecular Weight (Monoisotopic): 409.1081AlogP: 6.31#Rotatable Bonds: 3
Polar Surface Area: 72.60Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.75CX Basic pKa: CX LogP: 6.31CX LogD: 6.30
Aromatic Rings: 3Heavy Atoms: 29QED Weighted: 0.41Np Likeness Score: 0.08

References

1. Oh S, Cho SW, Yang J, Sun HJ, Chung YS, Shin CS, Park SB.  (2011)  Discovery of a novel benzopyranyl compound as a potent in vitro and in vivo osteogenic agent,  (1): [10.1039/C0MD00149J]

Source