(R)-2-((R)-3-amino-2-oxo-3-(4-((2-(trifluoromethyl)quinolin-4-yl)methoxy)phenyl)pyrrolidin-1-yl)-N-hydroxy-4-methylpentanamide

ID: ALA3221857

PubChem CID: 90668114

Max Phase: Preclinical

Molecular Formula: C27H29F3N4O4

Molecular Weight: 530.55

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)C[C@H](C(=O)NO)N1CC[C@@](N)(c2ccc(OCc3cc(C(F)(F)F)nc4ccccc34)cc2)C1=O

Standard InChI:  InChI=1S/C27H29F3N4O4/c1-16(2)13-22(24(35)33-37)34-12-11-26(31,25(34)36)18-7-9-19(10-8-18)38-15-17-14-23(27(28,29)30)32-21-6-4-3-5-20(17)21/h3-10,14,16,22,37H,11-13,15,31H2,1-2H3,(H,33,35)/t22-,26-/m1/s1

Standard InChI Key:  KQNNPPBFBXDAIH-ATIYNZHBSA-N

Molfile:  

     RDKit          2D

 38 41  0  0  0  0  0  0  0  0999 V2000
   12.2889   -5.7718    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.6992   -5.0549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5060   -5.2290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5935   -6.0494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8409   -6.3817    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3627   -4.3022    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3310   -5.2290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7455   -4.5120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5705   -4.5120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9810   -5.2290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5705   -5.9418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7455   -5.9418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8102   -5.2290    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.2206   -5.9418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6956   -5.9418    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.2852   -6.6545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4602   -6.6545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0456   -5.9418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4602   -5.2290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.0456   -4.5120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4602   -3.7992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2852   -3.7992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6956   -4.5120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2852   -5.2290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1725   -6.6288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4684   -5.8552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9455   -5.2168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1307   -5.3436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8348   -6.1131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6120   -4.7011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3452   -6.7607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7004   -7.2792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4011   -8.0616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7046   -7.3798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2861   -8.1056    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   20.5423   -7.3793    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   20.1176   -8.1020    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   13.5935   -4.4087    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  1  5  1  0
  2  6  2  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
  7 12  2  0
 13 14  1  0
 15 16  2  0
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 15 24  1  0
 19 24  1  0
 14 18  1  0
 10 13  1  0
  3  7  1  0
 25 26  1  0
 26 27  1  1
 27 28  1  0
 28 29  1  0
 28 30  1  0
  1 26  1  0
 25 31  2  0
 25 32  1  0
 32 33  1  0
 16 34  1  0
 34 35  1  0
 34 36  1  0
 34 37  1  0
  3 38  1  1
M  END

Associated Targets(Human)

Whole blood (398 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 530.55Molecular Weight (Monoisotopic): 530.2141AlogP: 4.14#Rotatable Bonds: 8
Polar Surface Area: 117.78Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.74CX Basic pKa: 7.46CX LogP: 3.69CX LogD: 3.51
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.30Np Likeness Score: -0.55

References

1. Argade A, Bahekar R, Desai J, Thombare P, Shah K, Gite S, Sunder R, Ranvir R, Bandyopadhyay D, Chakrabarti G, Joharapurkar A, Mahapatra J, Chatterjee A, Patel H, Shaikh M, Sairam KVVM, Jain M, Patel P.  (2011)  Design, synthesis and biological evaluation of -lactam hydroxamate based TACE inhibitors,  (10): [10.1039/C0MD00261E]

Source