The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-2-((R)-3-amino-3-(4-((2-(isopropoxymethyl)quinolin-4-yl)methoxy)phenyl)-2-oxopyrrolidin-1-yl)-N-hydroxy-4-methylpentanamide ID: ALA3221865
PubChem CID: 90668120
Max Phase: Preclinical
Molecular Formula: C30H38N4O5
Molecular Weight: 534.66
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)C[C@H](C(=O)NO)N1CC[C@@](N)(c2ccc(OCc3cc(COC(C)C)nc4ccccc34)cc2)C1=O
Standard InChI: InChI=1S/C30H38N4O5/c1-19(2)15-27(28(35)33-37)34-14-13-30(31,29(34)36)22-9-11-24(12-10-22)39-17-21-16-23(18-38-20(3)4)32-26-8-6-5-7-25(21)26/h5-12,16,19-20,27,37H,13-15,17-18,31H2,1-4H3,(H,33,35)/t27-,30-/m1/s1
Standard InChI Key: IGTWQTNHNBVGCR-POURPWNDSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
12.2889 -5.7718 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.6992 -5.0549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5060 -5.2290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5935 -6.0494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8409 -6.3817 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.3627 -4.3022 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3310 -5.2290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7455 -4.5120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5705 -4.5120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9810 -5.2290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.5705 -5.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7455 -5.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8102 -5.2290 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.2206 -5.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6956 -5.9418 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2852 -6.6545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4602 -6.6545 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0456 -5.9418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4602 -5.2290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.0456 -4.5120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.4602 -3.7992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2852 -3.7992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.6956 -4.5120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2852 -5.2290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1725 -6.6288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4684 -5.8552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.9455 -5.2168 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1307 -5.3436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8348 -6.1131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6120 -4.7011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3452 -6.7607 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.7004 -7.2792 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4011 -8.0616 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.7046 -7.3798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5423 -7.3793 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.9615 -8.1045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.7993 -8.1040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5431 -8.8302 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.5060 -4.4040 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
1 5 1 0
2 6 2 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
7 12 2 0
13 14 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
15 24 1 0
19 24 1 0
14 18 1 0
10 13 1 0
3 7 1 0
25 26 1 0
26 27 1 1
27 28 1 0
28 29 1 0
28 30 1 0
1 26 1 0
25 31 2 0
25 32 1 0
32 33 1 0
16 34 1 0
34 35 1 0
35 36 1 0
36 37 1 0
36 38 1 0
3 39 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 534.66Molecular Weight (Monoisotopic): 534.2842AlogP: 4.05#Rotatable Bonds: 11Polar Surface Area: 127.01Molecular Species: NEUTRALHBA: 7HBD: 3#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.74CX Basic pKa: 7.46CX LogP: 3.15CX LogD: 2.98Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.25Np Likeness Score: -0.54
References 1. Argade A, Bahekar R, Desai J, Thombare P, Shah K, Gite S, Sunder R, Ranvir R, Bandyopadhyay D, Chakrabarti G, Joharapurkar A, Mahapatra J, Chatterjee A, Patel H, Shaikh M, Sairam KVVM, Jain M, Patel P. (2011) Design, synthesis and biological evaluation of -lactam hydroxamate based TACE inhibitors, 2 (10): [10.1039/C0MD00261E ]