Your company account is blocked and you cannot place orders. If you have questions, please contact your company administrator.

3-O-galloyl-quinic acid

ID: ALA3233512

Cas Number: 17365-11-6

PubChem CID: 442988

Max Phase: Preclinical

Molecular Formula: C14H16O10

Molecular Weight: 344.27

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  O=C(O[C@@H]1C[C@](O)(C(=O)O)C[C@@H](O)[C@H]1O)c1cc(O)c(O)c(O)c1

Standard InChI:  InChI=1S/C14H16O10/c15-6-1-5(2-7(16)10(6)18)12(20)24-9-4-14(23,13(21)22)3-8(17)11(9)19/h1-2,8-9,11,15-19,23H,3-4H2,(H,21,22)/t8-,9-,11-,14+/m1/s1

Standard InChI Key:  LDPLFHGGZNSKDS-FTBFGRRBSA-N

Molfile:  

     RDKit          2D

 24 25  0  0  0  0  0  0  0  0999 V2000
   11.9687  -27.1721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6847  -27.5820    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3976  -27.1669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1136  -27.5767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3946  -26.3418    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.1128  -28.4011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8280  -28.8109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5418  -28.3957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5362  -27.5664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8204  -27.1604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2584  -28.8046    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.8306  -29.6359    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.2476  -27.1488    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.9698  -26.3475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2579  -25.9377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5425  -26.3493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5436  -27.1753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2601  -27.5897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6667  -25.3501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.8376  -25.3501    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6359  -25.5580    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.6185  -24.5546    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.8292  -27.5880    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2634  -28.4147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  1
  2  3  1  0
  3  4  1  0
  3  5  2  0
  4  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  4  1  0
  8 11  1  0
  7 12  1  0
  9 13  1  0
  1 14  1  0
  1 18  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 15 19  1  6
 15 20  1  0
 20 21  2  0
 20 22  1  0
 17 23  1  6
 18 24  1  6
M  END

Alternative Forms

  1. Parent:

    ALA3233512

    Theogallin

Associated Targets(non-human)

NA Neuraminidase (32 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Genome polyprotein (177 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Biocomponents

Calculated Properties

Molecular Weight: 344.27Molecular Weight (Monoisotopic): 344.0743AlogP: -1.34#Rotatable Bonds: 3
Polar Surface Area: 184.98Molecular Species: ACIDHBA: 9HBD: 7
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 7#RO5 Violations (Lipinski): 1
CX Acidic pKa: 2.72CX Basic pKa: CX LogP: -1.11CX LogD: -4.69
Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.26Np Likeness Score: 2.12

References

1. Abdel-Mageed WM, Bayoumi SA, Chen C, Vavricka CJ, Li L, Malik A, Dai H, Song F, Wang L, Zhang J, Gao GF, Lv Y, Liu L, Liu X, Sayed HM, Zhang L..  (2014)  Benzophenone C-glucosides and gallotannins from mango tree stem bark with broad-spectrum anti-viral activity.,  22  (7): [PMID:24613627] [10.1016/j.bmc.2014.02.014]

Source