(S)-2-[3-(4-Cyano-benzoylamino)-2,2-dimethyl-nonanoylamino]-3-phenyl-propionic acid benzyl ester

ID: ALA323355

PubChem CID: 10721712

Max Phase: Preclinical

Molecular Formula: C35H41N3O4

Molecular Weight: 567.73

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCCCCCC(NC(=O)c1ccc(C#N)cc1)C(C)(C)C(=O)N[C@@H](Cc1ccccc1)C(=O)OCc1ccccc1

Standard InChI:  InChI=1S/C35H41N3O4/c1-4-5-6-13-18-31(38-32(39)29-21-19-27(24-36)20-22-29)35(2,3)34(41)37-30(23-26-14-9-7-10-15-26)33(40)42-25-28-16-11-8-12-17-28/h7-12,14-17,19-22,30-31H,4-6,13,18,23,25H2,1-3H3,(H,37,41)(H,38,39)/t30-,31?/m0/s1

Standard InChI Key:  JOOSDCJBEPKADP-FSRLHOSWSA-N

Molfile:  

     RDKit          2D

 42 44  0  0  1  0  0  0  0  0999 V2000
    6.6667  -10.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9542  -11.3042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8167  -10.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3792  -11.3042    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.5292  -11.3125    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2417  -10.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8042  -11.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0917  -10.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2542  -12.9792    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.9667  -12.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1042  -11.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5167  -10.8792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.6667  -10.0667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8167  -10.0792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0917  -10.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8042  -12.1250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3917  -10.9042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1125  -12.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6792  -12.1417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2292  -11.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5417  -12.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3667  -12.0167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4000  -12.5542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6792  -11.3167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8042   -9.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2375  -12.1167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2417  -10.0750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5167  -10.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8000   -8.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5250  -12.5292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9542  -12.5167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5292   -9.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8167   -7.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8167   -8.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5292   -8.8375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1042   -7.1875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2292   -9.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5250  -13.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9542  -13.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5042   -8.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2292   -8.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2417  -13.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  5  1  0
  4  1  1  0
  5  6  1  0
  6  2  1  0
  7  8  1  0
  8  4  1  0
  9 10  3  0
 10 19  1  0
 11  3  1  0
 12  7  1  0
 13  1  2  0
 14  3  2  0
  8 15  1  1
 16  7  2  0
 17 11  2  0
 18 11  1  0
 19 23  1  0
 20 12  1  0
 21  2  1  0
 22  2  1  0
 23 18  2  0
 24 17  1  0
 25 15  1  0
 26 20  1  0
 27  6  1  0
 28 25  2  0
 29 25  1  0
 30 26  2  0
 31 26  1  0
 32 27  1  0
 33 34  1  0
 34 35  1  0
 35 32  1  0
 36 33  1  0
 37 28  1  0
 38 30  1  0
 39 31  2  0
 40 29  2  0
 41 40  1  0
 42 39  1  0
 41 37  2  0
 19 24  2  0
 42 38  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA323355

   (S)-2-[3-(4-Cyano-benzoylamino)-2,2-dimethyl-nonanoylamino]-3-phenyl-propionic acid benzyl ester

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 567.73

Molecular Weight (Monoisotopic): 567.3097

AlogP: 6.12

#Rotatable Bonds: 15

Polar Surface Area: 108.29

Molecular Species: NEUTRAL

HBA: 5

HBD: 2

#RO5 Violations: 2

HBA (Lipinski): 7

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 12.25

CX Basic pKa: ┄

CX LogP: 7.43

CX LogD: 7.43

Aromatic Rings: 3

Heavy Atoms: 42

QED Weighted: 0.17

Np Likeness Score: -0.40

References

1. Iijima K, Katada J, Yasuda E, Uno I, Hayashi Y..  (1999)  N-[2,2-dimethyl-3-(N-(4-cyanobenzoyl)amino)nonanoyl]-L-phenylalanine ethyl ester as a stable ester-type inhibitor of chymotrypsin-like serine proteases: structural requirements for potent inhibition of alpha-chymotrypsin.,  42  (2): [PMID:9925737] [10.1021/jm980562h]

Source

Source(1):

• Scientific Literature