The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-2-(4-Chlorophenyl)-1-(3-(7-chloroquinolin-4-ylamino)propyl)-3-(2-(4-methoxyphenoxy)phenyl)guanidine ID: ALA3235634
PubChem CID: 86580190
Max Phase: Preclinical
Molecular Formula: C32H29Cl2N5O2
Molecular Weight: 586.52
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(Oc2ccccc2N/C(=N/c2ccc(Cl)cc2)NCCCNc2ccnc3cc(Cl)ccc23)cc1
Standard InChI: InChI=1S/C32H29Cl2N5O2/c1-40-25-12-14-26(15-13-25)41-31-6-3-2-5-29(31)39-32(38-24-10-7-22(33)8-11-24)37-19-4-18-35-28-17-20-36-30-21-23(34)9-16-27(28)30/h2-3,5-17,20-21H,4,18-19H2,1H3,(H,35,36)(H2,37,38,39)
Standard InChI Key: QWOFTNRIHMKLIO-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
14.2817 -9.8507 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5768 -9.4421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8677 -9.8507 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.5768 -8.6249 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.1586 -9.4421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4495 -9.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7446 -9.4421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7446 -8.6249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4495 -8.2163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1586 -8.6249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.4495 -10.6679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.7446 -11.0764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7446 -11.8936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0355 -12.3022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3305 -11.8936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3305 -11.0764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0355 -10.6679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6214 -12.3022 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9123 -11.8936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9908 -9.4421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6999 -9.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4049 -9.4421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1140 -9.8507 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1140 -12.3022 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.4049 -11.8936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4049 -11.0764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1140 -10.6679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8231 -11.0764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5280 -10.6679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2371 -11.0764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2371 -11.8936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5280 -12.3022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8231 -11.8936 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9462 -12.3022 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
14.2817 -8.2163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.2817 -7.3991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9908 -6.9905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6999 -7.3991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6999 -8.2163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9908 -8.6249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4049 -6.9905 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
5 10 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
12 17 2 0
11 12 1 0
18 19 1 0
15 18 1 0
6 11 1 0
3 5 1 0
20 21 1 0
21 22 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
24 33 1 0
28 33 1 0
31 34 1 0
23 27 1 0
22 23 1 0
1 20 1 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 40 1 0
35 40 2 0
38 41 1 0
4 35 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 586.52Molecular Weight (Monoisotopic): 585.1698AlogP: 8.53#Rotatable Bonds: 10Polar Surface Area: 79.80Molecular Species: NEUTRALHBA: 5HBD: 3#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 7.78CX LogP: 7.08CX LogD: 6.45Aromatic Rings: 5Heavy Atoms: 41QED Weighted: 0.09Np Likeness Score: -1.16
References 1. Mishra A, Batchu H, Srivastava K, Singh P, Shukla PK, Batra S.. (2014) Synthesis and evaluation of new diaryl ether and quinoline hybrids as potential antiplasmodial and antimicrobial agents., 24 (7): [PMID:24630564 ] [10.1016/j.bmcl.2014.02.044 ]