5-Methyl-1-oxo-3-phenyl-1H-indene-2-carboxylic acid methyl ester; compound with 6-methyl-1-oxo-3-phenyl-1H-indene-2-carboxylic acid methyl ester

ID: ALA323564

Max Phase: Preclinical

Molecular Formula: C36H28O6

Molecular Weight: 556.61

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COC(=O)C1=C(c2ccccc2)c2cc(C)ccc2C1=O.COC(=O)C1=C(c2ccccc2)c2ccc(C)cc2C1=O

Standard InChI:  InChI=1S/2C18H14O3/c1-11-8-9-13-14(10-11)15(12-6-4-3-5-7-12)16(17(13)19)18(20)21-2;1-11-8-9-13-14(10-11)17(19)16(18(20)21-2)15(13)12-6-4-3-5-7-12/h2*3-10H,1-2H3

Standard InChI Key:  FMTKVFMCJBIQLL-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 42 46  0  0  0  0  0  0  0  0999 V2000
    3.9000   -3.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4125   -4.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4125   -3.0917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6250   -4.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6250   -3.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7250   -3.7625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9125   -2.9292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6667   -5.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9542   -4.6167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6625   -2.3042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1375   -3.0417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2000   -3.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2000   -4.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1292   -4.4792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4750   -5.3750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1125   -5.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4792   -4.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9500   -4.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7292   -6.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3750   -6.6042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1792   -6.7750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2167   -3.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7292   -4.4917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7292   -3.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9417   -4.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9417   -3.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0417   -3.8292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2792   -4.6792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9917   -5.2792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9792   -2.3667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2292   -2.9917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4542   -3.1042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5167   -4.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5167   -3.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4542   -4.5417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.7917   -5.4417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4292   -5.8917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8042   -3.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2667   -4.5417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0542   -6.2167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6917   -6.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5042   -6.8417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  1  1  0
  4  2  1  0
  5  3  1  0
  6  1  1  0
  7  5  2  0
  8  2  1  0
  9  4  2  0
 10  3  2  0
 11  6  2  0
 12  7  1  0
 13  9  1  0
 14  6  1  0
 15  8  1  0
 16  8  2  0
 17 13  1  0
 18 14  1  0
 19 15  2  0
 20 16  1  0
 21 20  2  0
  4  5  1  0
 13 12  2  0
 21 19  1  0
 23 22  2  0
 24 22  1  0
 25 23  1  0
 26 24  1  0
 27 22  1  0
 28 25  2  0
 29 23  1  0
 30 24  2  0
 31 26  2  0
 32 27  2  0
 33 28  1  0
 34 31  1  0
 35 27  1  0
 36 29  1  0
 37 29  2  0
 38 34  1  0
 39 35  1  0
 40 36  2  0
 41 37  1  0
 42 41  2  0
 25 26  1  0
 33 34  2  0
 42 40  1  0
M  END

Alternative Forms

  1. Parent:

    ALA323564

    ---

Associated Targets(Human)

FGFR3 Tclin Fibroblast growth factor receptor (331 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PDGFRB Tclin Platelet-derived growth factor receptor (507 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SRC Tclin Tyrosine-protein kinase SRC (10310 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 556.61Molecular Weight (Monoisotopic): 556.1886AlogP: #Rotatable Bonds:
Polar Surface Area: Molecular Species: HBA: HBD:
#RO5 Violations: HBA (Lipinski): HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: CX LogD:
Aromatic Rings: Heavy Atoms: QED Weighted: Np Likeness Score:

References

1. Barvian M, Panek R, Lu G, Kraker A, Amar A, Hartl B, Hamby J, Showalter H.  (1997)  1-Oxo-3-aryl-1H-indene-2-carboxylic acid derivatives as selective inhibitors of fibroblast growth factor receptor-1 tyrosine kinase,  (22): [10.1016/S0960-894X(97)10110-X]

Source