The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Methyl 4-(1-(2-(7-Chloro-1H-indol-3-yl)ethyl)-4-hydroxy-3-nicotinoyl-5-oxo-2,5-dihydro-1H-pyrrol-2-yl)benzoate ID: ALA3237289
PubChem CID: 90655044
Max Phase: Preclinical
Molecular Formula: C28H22ClN3O5
Molecular Weight: 515.95
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccc(C2C(C(=O)c3cccnc3)=C(O)C(=O)N2CCc2c[nH]c3c(Cl)cccc23)cc1
Standard InChI: InChI=1S/C28H22ClN3O5/c1-37-28(36)17-9-7-16(8-10-17)24-22(25(33)19-4-3-12-30-14-19)26(34)27(35)32(24)13-11-18-15-31-23-20(18)5-2-6-21(23)29/h2-10,12,14-15,24,31,34H,11,13H2,1H3
Standard InChI Key: BEYNTSQRUADDKW-UHFFFAOYSA-N
Molfile:
RDKit 2D
37 41 0 0 0 0 0 0 0 0999 V2000
12.9604 -7.8046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9506 -6.9852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6553 -6.5670 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3698 -6.9681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3797 -7.7875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6750 -8.2057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8573 -6.7933 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0745 -6.5499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0648 -5.7303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8410 -5.4675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3308 -6.1245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1501 -6.1144 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
14.3960 -5.2568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4170 -4.4376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1368 -4.0460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.1575 -3.2269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4585 -2.7993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7387 -3.1909 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.7179 -4.0101 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6516 -5.5993 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.0846 -4.6851 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.1201 -7.5695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9237 -7.7299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.2028 -9.8319 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.7130 -9.1749 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1865 -8.5061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9689 -8.7497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6734 -8.3313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3881 -8.7322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.3982 -9.5516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.6936 -9.9700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.9790 -9.5691 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2577 -8.2217 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5451 -7.8216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2675 -9.0388 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8424 -8.2387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.7037 -10.7872 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 2 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
7 11 1 0
11 12 2 0
13 14 1 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 19 1 0
14 19 2 0
13 20 2 0
9 13 1 0
10 21 1 0
22 23 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
24 32 1 0
27 32 2 0
23 26 1 0
7 22 1 0
4 8 1 0
1 33 1 0
33 34 1 0
33 35 2 0
34 36 1 0
31 37 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 515.95Molecular Weight (Monoisotopic): 515.1248AlogP: 4.82#Rotatable Bonds: 7Polar Surface Area: 112.59Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.27CX Basic pKa: 3.71CX LogP: 3.75CX LogD: 3.75Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.27Np Likeness Score: -0.97
References 1. Zimmerman SS, Khatri A, Garnier-Amblard EC, Mullasseril P, Kurtkaya NL, Gyoneva S, Hansen KB, Traynelis SF, Liotta DC.. (2014) Design, synthesis, and structure-activity relationship of a novel series of GluN2C-selective potentiators., 57 (6): [PMID:24512267 ] [10.1021/jm401695d ]