The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 4-(3-Acetyl-4-hydroxy-1-(2-(2-methyl-1H-indol-3-yl)ethyl)-5-oxo-2,5-dihydro-1H-pyrrol-2-yl)benzoate ID: ALA3237294
PubChem CID: 73335701
Max Phase: Preclinical
Molecular Formula: C26H26N2O5
Molecular Weight: 446.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1ccc(C2C(C(C)=O)=C(O)C(=O)N2CCc2c(C)[nH]c3ccccc23)cc1
Standard InChI: InChI=1S/C26H26N2O5/c1-4-33-26(32)18-11-9-17(10-12-18)23-22(16(3)29)24(30)25(31)28(23)14-13-19-15(2)27-21-8-6-5-7-20(19)21/h5-12,23,27,30H,4,13-14H2,1-3H3
Standard InChI Key: ZBEMOCUXMQAKPF-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
3.9267 -4.6301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6271 -4.2102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6162 -3.3894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8975 -2.9928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1970 -3.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2079 -4.2336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1029 -3.2267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3234 -2.9738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3236 -2.1540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1029 -1.9008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5846 -2.5638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4040 -2.5638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3561 -1.1215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6606 -1.6724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7463 -0.8574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9120 -2.0057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3561 -4.0060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1577 -4.1764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4109 -6.2816 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9292 -5.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4109 -4.9558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1902 -5.2090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8999 -4.7993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6095 -5.2090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6095 -6.0284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8999 -6.4381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1902 -6.0284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5070 -4.6537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7927 -4.2568 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5204 -5.4708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0918 -4.6769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1120 -5.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3775 -4.2800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 2 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
7 11 1 0
11 12 2 0
10 13 1 0
14 15 2 0
14 16 1 0
9 14 1 0
17 18 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
19 27 1 0
22 27 2 0
18 21 1 0
7 17 1 0
3 8 1 0
6 28 1 0
28 29 1 0
28 30 2 0
29 31 1 0
20 32 1 0
31 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 446.50Molecular Weight (Monoisotopic): 446.1842AlogP: 4.18#Rotatable Bonds: 7Polar Surface Area: 99.70Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.75CX Basic pKa: ┄CX LogP: 3.50CX LogD: 3.50Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.53Np Likeness Score: -0.79
References 1. Zimmerman SS, Khatri A, Garnier-Amblard EC, Mullasseril P, Kurtkaya NL, Gyoneva S, Hansen KB, Traynelis SF, Liotta DC.. (2014) Design, synthesis, and structure-activity relationship of a novel series of GluN2C-selective potentiators., 57 (6): [PMID:24512267 ] [10.1021/jm401695d ] 2. (2014) NMDA receptor modulators and uses related thereto,