The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Ethyl 4-(1-(2-(1H-Indol-3-yl)ethyl)-3-acetyl-4-hydroxy-5-oxo-2,5-dihydro-1H-pyrrol-2-yl)-3-hydroxybenzoate ID: ALA3237295
PubChem CID: 90035960
Max Phase: Preclinical
Molecular Formula: C25H24N2O6
Molecular Weight: 448.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)c1ccc(C2C(C(C)=O)=C(O)C(=O)N2CCc2c[nH]c3ccccc23)c(O)c1
Standard InChI: InChI=1S/C25H24N2O6/c1-3-33-25(32)15-8-9-18(20(29)12-15)22-21(14(2)28)23(30)24(31)27(22)11-10-16-13-26-19-7-5-4-6-17(16)19/h4-9,12-13,22,26,29-30H,3,10-11H2,1-2H3
Standard InChI Key: CNXFBAHAJJGIJV-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
3.9267 -4.6301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6271 -4.2102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6162 -3.3894 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8975 -2.9928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1970 -3.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2079 -4.2336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1029 -3.2267 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3234 -2.9738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3236 -2.1540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1029 -1.9008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5846 -2.5638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4040 -2.5638 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.3561 -1.1215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.6606 -1.6724 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7463 -0.8574 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9120 -2.0057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3561 -4.0060 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1577 -4.1764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4109 -6.2816 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.9292 -5.6187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4109 -4.9558 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1902 -5.2090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8999 -4.7993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6095 -5.2090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.6095 -6.0284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8999 -6.4381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1902 -6.0284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5070 -4.6537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7927 -4.2568 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5204 -5.4708 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0918 -4.6769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3775 -4.2800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3409 -4.6082 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 2 0
7 8 1 0
8 9 1 0
9 10 2 0
10 11 1 0
7 11 1 0
11 12 2 0
10 13 1 0
14 15 2 0
14 16 1 0
9 14 1 0
17 18 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
19 27 1 0
22 27 2 0
18 21 1 0
7 17 1 0
3 8 1 0
6 28 1 0
28 29 1 0
28 30 2 0
29 31 1 0
31 32 1 0
2 33 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.48Molecular Weight (Monoisotopic): 448.1634AlogP: 3.58#Rotatable Bonds: 7Polar Surface Area: 119.93Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.70CX Basic pKa: ┄CX LogP: 3.00CX LogD: 2.98Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.48Np Likeness Score: -0.44
References 1. Zimmerman SS, Khatri A, Garnier-Amblard EC, Mullasseril P, Kurtkaya NL, Gyoneva S, Hansen KB, Traynelis SF, Liotta DC.. (2014) Design, synthesis, and structure-activity relationship of a novel series of GluN2C-selective potentiators., 57 (6): [PMID:24512267 ] [10.1021/jm401695d ]