Methyl 4-(3-Acetyl-4-(acryloyloxy)-1-(2-(2-methyl-1H-indol-3-yl)-ethyl)-5-oxo-2,5-dihydro-1H-pyrrol-2-yl)benzoate

ID: ALA3237302

Max Phase: Preclinical

Molecular Formula: C28H26N2O6

Molecular Weight: 486.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  C=CC(=O)OC1=C(C(C)=O)C(c2ccc(C(=O)OC)cc2)N(CCc2c(C)[nH]c3ccccc23)C1=O

Standard InChI:  InChI=1S/C28H26N2O6/c1-5-23(32)36-26-24(17(3)31)25(18-10-12-19(13-11-18)28(34)35-4)30(27(26)33)15-14-20-16(2)29-22-9-7-6-8-21(20)22/h5-13,25,29H,1,14-15H2,2-4H3

Standard InChI Key:  ZBKIRCHNGKVOLM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 36 39  0  0  0  0  0  0  0  0999 V2000
   12.5213   -8.5759    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2233   -8.1531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2081   -7.3338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9101   -6.9110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6272   -7.3076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6423   -8.1269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9404   -8.5496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8042   -8.1793    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5793   -9.3933    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1123   -7.1260    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.3292   -6.8848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.3167   -6.0654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.0920   -5.8003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5838   -6.4558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4031   -6.4432    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.3775   -7.9014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1815   -8.0595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4669  -10.1606    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.9752   -9.5051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4466   -8.8348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2298   -9.0761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9331   -8.6556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6489   -9.0544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.6615   -9.8737    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.9582  -10.2942    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2423   -9.8954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1558   -9.5176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3333   -5.0171    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.1406   -4.8766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.6660   -5.5054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.4225   -4.1072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2298   -3.9666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6464   -5.5939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9030   -5.9387    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.7196   -4.7778    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3162   -9.7517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  2  7  2  0
  1  8  2  0
  1  9  1  0
 10 11  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 10 14  1  0
 14 15  2  0
 16 17  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 18 26  1  0
 21 26  2  0
 19 27  1  0
 17 20  1  0
 10 16  1  0
 29 30  2  0
 29 31  1  0
 31 32  2  0
 28 29  1  0
 13 28  1  0
 33 34  2  0
 33 35  1  0
 12 33  1  0
  5 11  1  0
  9 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3237302

    ---

Associated Targets(non-human)

Grin1 Ionotropic glutamate receptor NMDA 1/2D (870 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Grin1 Glutamate NMDA receptor; Grin1/Grin2c (1127 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Grin1 Glutamate NMDA receptor; Grin1/Grin2a (798 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Grin1 Glutamate NMDA receptor; Grin1/Grin2b (1028 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 486.52Molecular Weight (Monoisotopic): 486.1791AlogP: 3.96#Rotatable Bonds: 8
Polar Surface Area: 105.77Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 10.59CX Basic pKa: CX LogP: 4.04CX LogD: 4.04
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.38Np Likeness Score: -0.32

References

1. Zimmerman SS, Khatri A, Garnier-Amblard EC, Mullasseril P, Kurtkaya NL, Gyoneva S, Hansen KB, Traynelis SF, Liotta DC..  (2014)  Design, synthesis, and structure-activity relationship of a novel series of GluN2C-selective potentiators.,  57  (6): [PMID:24512267] [10.1021/jm401695d]

Source