The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2,4-dinitrophenoxy)-1-(4-(2-fluoro-5-((4-oxo-3,4-dihydrophthalazin-1-yl)methyl)benzoyl)piperazin-1-yl)diazene oxide ID: ALA3237591
PubChem CID: 71543402
Max Phase: Preclinical
Molecular Formula: C26H21FN8O8
Molecular Weight: 592.50
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1cc(Cc2n[nH]c(=O)c3ccccc23)ccc1F)N1CCN(/[N+]([O-])=N/Oc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])CC1
Standard InChI: InChI=1S/C26H21FN8O8/c27-21-7-5-16(14-22-18-3-1-2-4-19(18)25(36)29-28-22)13-20(21)26(37)31-9-11-32(12-10-31)35(42)30-43-24-8-6-17(33(38)39)15-23(24)34(40)41/h1-8,13,15H,9-12,14H2,(H,29,36)/b35-30-
Standard InChI Key: ZTILXVUHIIMORJ-GXVXDJONSA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
10.1185 -2.0099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.1174 -2.8295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8254 -3.2384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8237 -1.6011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5323 -2.0063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.5311 -2.8270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2373 -3.2360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9492 -2.8290 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.9504 -2.0083 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
12.2396 -1.5947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2396 -0.7775 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12.2350 -4.0532 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9416 -4.4638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.9380 -5.2798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6437 -5.6903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3535 -5.2836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3532 -4.4622 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6469 -4.0554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.0606 -4.0531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.7686 -4.4611 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.0600 -3.2359 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.7644 -5.2752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4684 -5.6832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.1782 -5.2775 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.1795 -4.4594 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.4711 -4.0469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8846 -5.6883 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.8821 -6.5055 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.5886 -6.9162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5861 -7.7334 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8770 -8.1354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.8741 -8.9518 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.5811 -9.3634 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2924 -8.9526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.2918 -8.1375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.9999 -7.7250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.9981 -6.9078 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
20.7085 -8.1320 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5811 -10.1850 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
19.2881 -10.5948 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.8727 -10.5924 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
18.5936 -5.2819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.0606 -5.6932 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
5 10 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 1 0
10 11 2 0
7 12 1 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
17 19 1 0
19 20 1 0
19 21 2 0
20 22 1 0
20 26 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
24 27 1 0
27 28 2 0
28 29 1 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
36 37 2 0
36 38 1 0
35 36 1 0
39 40 2 0
39 41 1 0
33 39 1 0
27 42 1 0
16 43 1 0
M CHG 6 27 1 36 1 38 -1 39 1 41 -1 42 -1
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 592.50Molecular Weight (Monoisotopic): 592.1466AlogP: 3.10#Rotatable Bonds: 8Polar Surface Area: 203.24Molecular Species: ACIDHBA: 10HBD: 1#RO5 Violations: 1HBA (Lipinski): 16HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 2.60CX Basic pKa: ┄CX LogP: 0.31CX LogD: 2.33Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.14Np Likeness Score: -1.35
References 1. Maciag AE, Holland RJ, Kim Y, Kumari V, Luthers CE, Sehareen WS, Biswas D, Morris NL, Ji X, Anderson LM, Saavedra JE, Keefer LK.. (2014) Nitric oxide (NO) releasing poly ADP-ribose polymerase 1 (PARP-1) inhibitors targeted to glutathione S-transferase P1-overexpressing cancer cells., 57 (6): [PMID:24521039 ] [10.1021/jm401550d ]