(2S)-3-Amino-2-(4-((2S)-4-((6-amino-3-pyridinyl)sulfonyl)-2-(1-propyn-1-yl)-1-piperazinyl)phenyl)-1,1,1-trifluoro-2-propanol

ID: ALA3237982

PubChem CID: 90045230

Max Phase: Preclinical

Molecular Formula: C21H24F3N5O3S

Molecular Weight: 483.52

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC#C[C@H]1CN(S(=O)(=O)c2ccc(N)nc2)CCN1c1ccc([C@](O)(CN)C(F)(F)F)cc1

Standard InChI:  InChI=1S/C21H24F3N5O3S/c1-2-3-17-13-28(33(31,32)18-8-9-19(26)27-12-18)10-11-29(17)16-6-4-15(5-7-16)20(30,14-25)21(22,23)24/h4-9,12,17,30H,10-11,13-14,25H2,1H3,(H2,26,27)/t17-,20+/m0/s1

Standard InChI Key:  RYBULNCBQJIBFU-FXAWDEMLSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
   12.6374   -7.9624    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4624   -7.9666    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   13.0535   -7.2500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.7568   -9.2082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7556  -10.0356    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4705  -10.4484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1868  -10.0351    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1840   -9.2045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4686   -8.7955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1794   -7.5558    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.8953   -7.9638    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6065   -7.5527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6083   -6.7274    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.8927   -6.3148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1754   -6.7276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3185   -6.3172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0329   -6.7320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7472   -6.3208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7483   -5.4949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0292   -5.0819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3178   -5.4956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4703  -11.2734    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.3186   -7.9604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0326   -8.3734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7414   -8.7832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4626   -5.0820    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1773   -5.4941    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4621   -4.2570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1764   -3.8441    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   17.7475   -3.8450    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   18.4540   -3.4291    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   19.1777   -6.3191    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.1748   -4.6625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  2  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  9  2  1  0
  2 10  1  0
 10 11  1  0
 10 15  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 16  1  0
 13 16  1  0
  6 22  1  0
 23 24  3  0
 12 23  1  1
 24 25  1  0
 19 26  1  0
 26 27  1  0
 26 28  1  1
 28 29  1  0
 28 30  1  0
 28 31  1  0
 27 32  1  0
 26 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3237982

    CID 90045230

Associated Targets(Human)

GCKR Tchem Glucokinase regulatory protein (190 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Gckr Glucokinase regulatory protein (72 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Liver microsome (4459 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 483.52Molecular Weight (Monoisotopic): 483.1552AlogP: 1.28#Rotatable Bonds: 5
Polar Surface Area: 125.78Molecular Species: BASEHBA: 7HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 10.59CX Basic pKa: 8.73CX LogP: 1.48CX LogD: 0.26
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.55Np Likeness Score: -0.92

References

1. Nishimura N, Norman MH, Liu L, Yang KC, Ashton KS, Bartberger MD, Chmait S, Chen J, Cupples R, Fotsch C, Helmering J, Jordan SR, Kunz RK, Pennington LD, Poon SF, Siegmund A, Sivits G, Lloyd DJ, Hale C, St Jean DJ..  (2014)  Small molecule disruptors of the glucokinase-glucokinase regulatory protein interaction: 3. Structure-activity relationships within the aryl carbinol region of the N-arylsulfonamido-N'-arylpiperazine series.,  57  (7): [PMID:24611879] [10.1021/jm5000497]

Source