The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-((2S)-4-((6-Amino-3-pyridinyl)sulfonyl)-2-(1-propyn-1-yl)-1-piperazinyl)-5-pyrimidinyl)-1,1,1,3,3,3-hexafluoro-2-propanol ID: ALA3238310
PubChem CID: 87058555
Max Phase: Preclinical
Molecular Formula: C19H18F6N6O3S
Molecular Weight: 524.45
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC#C[C@H]1CN(S(=O)(=O)c2ccc(N)nc2)CCN1c1ncc(C(O)(C(F)(F)F)C(F)(F)F)cn1
Standard InChI: InChI=1S/C19H18F6N6O3S/c1-2-3-13-11-30(35(33,34)14-4-5-15(26)27-10-14)6-7-31(13)16-28-8-12(9-29-16)17(32,18(20,21)22)19(23,24)25/h4-5,8-10,13,32H,6-7,11H2,1H3,(H2,26,27)/t13-/m0/s1
Standard InChI Key: CWDXIMHMPWZRFK-ZDUSSCGKSA-N
Molfile:
RDKit 2D
35 37 0 0 0 0 0 0 0 0999 V2000
10.0412 -15.7990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3636 -21.5486 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7527 -17.8487 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.7497 -16.2003 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0741 -22.7783 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.7832 -19.0813 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.9100 -19.4816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6203 -18.2616 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4623 -17.4378 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
10.7514 -15.3862 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.0725 -20.3126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3305 -17.8504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6165 -16.6198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7793 -18.2572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4924 -17.8444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7878 -20.7218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0743 -21.9574 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2020 -19.0782 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2454 -19.4838 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7907 -21.5482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4950 -19.4852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9099 -17.8468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6615 -18.7756 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.3316 -17.0286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7523 -17.0278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0662 -19.4879 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
10.0416 -16.6198 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3247 -20.3005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9093 -17.0293 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.4665 -16.6191 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.6201 -19.8948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3648 -20.7254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2039 -18.2569 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.0331 -14.9753 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.3307 -15.3869 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 17 1 0
13 29 2 0
6 21 1 0
33 15 1 0
15 14 1 0
27 25 1 0
20 16 1 0
25 9 1 0
1 34 1 0
11 32 1 0
26 6 1 0
21 18 1 0
29 22 1 0
17 5 1 0
22 8 2 0
6 14 1 0
24 13 1 0
24 27 1 0
26 19 2 0
18 33 1 0
23 26 2 0
27 1 1 0
17 20 2 0
25 30 1 0
11 26 1 0
8 12 1 0
7 31 3 0
31 28 1 0
16 11 2 0
25 3 1 0
33 22 1 0
12 24 2 0
1 35 1 0
27 4 1 0
18 7 1 1
1 10 1 0
32 2 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 524.45Molecular Weight (Monoisotopic): 524.1065AlogP: 1.67#Rotatable Bonds: 4Polar Surface Area: 125.54Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 7.12CX Basic pKa: 3.18CX LogP: 2.32CX LogD: 1.86Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.46Np Likeness Score: -0.85
References 1. Nishimura N, Norman MH, Liu L, Yang KC, Ashton KS, Bartberger MD, Chmait S, Chen J, Cupples R, Fotsch C, Helmering J, Jordan SR, Kunz RK, Pennington LD, Poon SF, Siegmund A, Sivits G, Lloyd DJ, Hale C, St Jean DJ.. (2014) Small molecule disruptors of the glucokinase-glucokinase regulatory protein interaction: 3. Structure-activity relationships within the aryl carbinol region of the N-arylsulfonamido-N'-arylpiperazine series., 57 (7): [PMID:24611879 ] [10.1021/jm5000497 ]