2-(2-((2S)-4-((6-Amino-3-pyridinyl)sulfonyl)-2-(1-propyn-1-yl)-1-piperazinyl)-5-pyrimidinyl)-1,1,1,3,3,3-hexafluoro-2-propanol

ID: ALA3238310

PubChem CID: 87058555

Max Phase: Preclinical

Molecular Formula: C19H18F6N6O3S

Molecular Weight: 524.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC#C[C@H]1CN(S(=O)(=O)c2ccc(N)nc2)CCN1c1ncc(C(O)(C(F)(F)F)C(F)(F)F)cn1

Standard InChI:  InChI=1S/C19H18F6N6O3S/c1-2-3-13-11-30(35(33,34)14-4-5-15(26)27-10-14)6-7-31(13)16-28-8-12(9-29-16)17(32,18(20,21)22)19(23,24)25/h4-5,8-10,13,32H,6-7,11H2,1H3,(H2,26,27)/t13-/m0/s1

Standard InChI Key:  CWDXIMHMPWZRFK-ZDUSSCGKSA-N

Molfile:  

     RDKit          2D

 35 37  0  0  0  0  0  0  0  0999 V2000
   10.0412  -15.7990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3636  -21.5486    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7527  -17.8487    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.7497  -16.2003    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0741  -22.7783    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.7832  -19.0813    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.9100  -19.4816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6203  -18.2616    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4623  -17.4378    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   10.7514  -15.3862    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.0725  -20.3126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3305  -17.8504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6165  -16.6198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7793  -18.2572    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4924  -17.8444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7878  -20.7218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0743  -21.9574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2020  -19.0782    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2454  -19.4838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7907  -21.5482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4950  -19.4852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9099  -17.8468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6615  -18.7756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.3316  -17.0286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7523  -17.0278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0662  -19.4879    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   10.0416  -16.6198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3247  -20.3005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9093  -17.0293    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.4665  -16.6191    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.6201  -19.8948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3648  -20.7254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2039  -18.2569    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.0331  -14.9753    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.3307  -15.3869    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2 17  1  0
 13 29  2  0
  6 21  1  0
 33 15  1  0
 15 14  1  0
 27 25  1  0
 20 16  1  0
 25  9  1  0
  1 34  1  0
 11 32  1  0
 26  6  1  0
 21 18  1  0
 29 22  1  0
 17  5  1  0
 22  8  2  0
  6 14  1  0
 24 13  1  0
 24 27  1  0
 26 19  2  0
 18 33  1  0
 23 26  2  0
 27  1  1  0
 17 20  2  0
 25 30  1  0
 11 26  1  0
  8 12  1  0
  7 31  3  0
 31 28  1  0
 16 11  2  0
 25  3  1  0
 33 22  1  0
 12 24  2  0
  1 35  1  0
 27  4  1  0
 18  7  1  1
  1 10  1  0
 32  2  2  0
M  END

Alternative Forms

  1. Parent:

    ALA3238310

    CID 87058555

Associated Targets(Human)

GCKR Tchem Glucokinase regulatory protein (190 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Gckr Glucokinase regulatory protein (72 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Liver microsome (4459 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 524.45Molecular Weight (Monoisotopic): 524.1065AlogP: 1.67#Rotatable Bonds: 4
Polar Surface Area: 125.54Molecular Species: NEUTRALHBA: 8HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.12CX Basic pKa: 3.18CX LogP: 2.32CX LogD: 1.86
Aromatic Rings: 2Heavy Atoms: 35QED Weighted: 0.46Np Likeness Score: -0.85

References

1. Nishimura N, Norman MH, Liu L, Yang KC, Ashton KS, Bartberger MD, Chmait S, Chen J, Cupples R, Fotsch C, Helmering J, Jordan SR, Kunz RK, Pennington LD, Poon SF, Siegmund A, Sivits G, Lloyd DJ, Hale C, St Jean DJ..  (2014)  Small molecule disruptors of the glucokinase-glucokinase regulatory protein interaction: 3. Structure-activity relationships within the aryl carbinol region of the N-arylsulfonamido-N'-arylpiperazine series.,  57  (7): [PMID:24611879] [10.1021/jm5000497]

Source