1-(tert-butylamino)-3-((cis)-6,7-dimethoxy-5,6,7,8-tetrahydronaphthalen-1-yloxy)propan-2-ol hydrochloride

ID: ALA3244454

PubChem CID: 12445670

Max Phase: Preclinical

Molecular Formula: C19H32ClNO4

Molecular Weight: 337.46

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CO[C@H]1Cc2cccc(OCC(O)CNC(C)(C)C)c2C[C@H]1OC.Cl

Standard InChI:  InChI=1S/C19H31NO4.ClH/c1-19(2,3)20-11-14(21)12-24-16-8-6-7-13-9-17(22-4)18(23-5)10-15(13)16;/h6-8,14,17-18,20-21H,9-12H2,1-5H3;1H/t14?,17-,18+;/m0./s1

Standard InChI Key:  VOCMLGLGVDZTSO-HRZYPINMSA-N

Molfile:  

     RDKit          2D

 25 25  0  0  0  0  0  0  0  0999 V2000
   18.1500   -3.1232    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   16.6854   -5.6251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4032   -6.0342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.4071   -6.8568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6954   -7.2739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9797   -6.8684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2679   -7.2855    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5502   -6.8765    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5441   -6.0503    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.2558   -5.6332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.9737   -6.0423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6794   -4.7989    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   17.3908   -4.3813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1083   -4.7885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.8197   -4.3708    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1143   -5.6135    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.5372   -4.7780    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   20.2486   -4.3604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9661   -4.7676    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.2425   -3.5354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9580   -3.9416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8383   -7.2936    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.1213   -6.8857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8268   -5.6427    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8211   -4.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
  2 11  2  0
  6 11  1  0
  2 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  0
 15 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  1  0
 18 21  1  0
  8 22  1  6
 22 23  1  0
  9 24  1  6
 24 25  1  0
M  END

Associated Targets(non-human)

Adrb1 Adrenergic receptor beta (703 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 337.46Molecular Weight (Monoisotopic): 337.2253AlogP: 1.94#Rotatable Bonds: 7
Polar Surface Area: 59.95Molecular Species: BASEHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 9.76CX LogP: 2.15CX LogD: -0.16
Aromatic Rings: 1Heavy Atoms: 24QED Weighted: 0.80Np Likeness Score: 0.25

References

1. Condon ME, Cimarusti CM, Fox R, Narayanan VL, Reid J, Sundeen JE, Hauck FP..  (1978)  Nondepressant beta-adrenergic blocking agents. 1. Substituted 3-amino-1-(5,6,7,8-tetrahydro-1-naphthoxy)-2-propanols.,  21  (9): [PMID:31485] [10.1021/jm00207a014]

Source