(S)-diethyl 2-(4-((2,4-diamino-5-methylquinazolin-6-yl)methylamino)benzamido)pentanedioate

ID: ALA3244832

PubChem CID: 90672037

Max Phase: Preclinical

Molecular Formula: C26H32N6O5

Molecular Weight: 508.58

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  CCOC(=O)CC[C@H](NC(=O)c1ccc(NCc2ccc3nc(N)nc(N)c3c2C)cc1)C(=O)OCC

Standard InChI:  InChI=1S/C26H32N6O5/c1-4-36-21(33)13-12-20(25(35)37-5-2)30-24(34)16-6-9-18(10-7-16)29-14-17-8-11-19-22(15(17)3)23(27)32-26(28)31-19/h6-11,20,29H,4-5,12-14H2,1-3H3,(H,30,34)(H4,27,28,31,32)/t20-/m0/s1

Standard InChI Key:  FIITZYADNJQCEM-FQEVSTJZSA-N

Molfile:  

     RDKit          2D

 37 39  0  0  0  0  0  0  0  0999 V2000
   11.4489  -17.6150    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.1464  -16.3892    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8522  -17.6150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8522  -16.7978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1464  -18.0236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4489  -16.7978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5579  -18.0236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4982  -19.2742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5579  -16.3892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.2122  -18.8738    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.2637  -17.6233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6279  -18.8779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6835  -17.6274    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.9180  -19.2865    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7925  -18.8656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9695  -18.0360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3810  -18.0442    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4982  -20.0913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.6279  -18.0608    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.2637  -16.8061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0826  -19.2742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.7925  -18.0484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3810  -18.8614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0867  -17.6398    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7349  -16.3892    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   19.9098  -20.1037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6155  -20.5123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.3336  -19.2865    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1443  -18.8408    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.0418  -18.8788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.7491  -19.2882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6145  -21.3295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.9062  -21.7410    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   21.3217  -21.7426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.1974  -21.3342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.4908  -21.7447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5543  -18.8408    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  6  2  0
  3  5  1  0
  4  2  1  0
  5  1  2  0
  6  1  1  0
  7  3  2  0
  8 15  1  0
  9  4  2  0
 10  8  1  0
 11  7  1  0
 12 14  1  0
 13 16  1  0
 14 10  1  6
 15 22  1  0
 16 11  1  0
 17 13  1  0
 18  8  2  0
 19 12  2  0
 20  9  1  0
 21 23  1  0
 22 24  2  0
 23 17  2  0
 24 17  1  0
 25  6  1  0
 26 14  1  0
 27 26  1  0
 28 12  1  0
  3  4  1  0
 11 20  2  0
 21 15  2  0
  5 29  1  0
 28 30  1  0
 30 31  1  0
 27 32  1  0
 32 33  1  0
 32 34  2  0
 33 35  1  0
 35 36  1  0
  7 37  1  0
M  END

Alternative Forms

1. Parent:

   

   ALA3244832

   diethyl (2S)-2-[[4-[(2,4-diamino-5-methylquinazolin-6-yl)methylamino]benzoyl]amino]pentanedioate

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 508.58

Molecular Weight (Monoisotopic): 508.2434

AlogP: 2.72

#Rotatable Bonds: 11

Polar Surface Area: 171.55

Molecular Species: NEUTRAL

HBA: 10

HBD: 4

#RO5 Violations: 1

HBA (Lipinski): 11

HBD (Lipinski): 6

#RO5 Violations (Lipinski): 3

CX Acidic pKa: ┄

CX Basic pKa: 7.86

CX LogP: 2.52

CX LogD: 2.16

Aromatic Rings: 3

Heavy Atoms: 37

QED Weighted: 0.28

Np Likeness Score: -0.70

References

1. Hynes JB, Eason DE, Garrett CM, Colvin PL..  (1977)  Quinazolines as inhibitors of dihydrofolate reductase. 4. Classical analogues of folic and isofolic acids.,  20  (4): [PMID:850245] [10.1021/jm00214a030]

Source

Source(1):

• Scientific Literature